diff --git a/core/assets/vendor/select2/.gitignore b/core/assets/vendor/select2/.gitignore
new file mode 100644
index 0000000..c6ef218
--- /dev/null
+++ b/core/assets/vendor/select2/.gitignore
@@ -0,0 +1,2 @@
+.idea
+
diff --git a/core/assets/vendor/select2/CONTRIBUTING.md b/core/assets/vendor/select2/CONTRIBUTING.md
new file mode 100644
index 0000000..bca4baf
--- /dev/null
+++ b/core/assets/vendor/select2/CONTRIBUTING.md
@@ -0,0 +1,107 @@
+Contributing to Select2
+=======================
+Looking to contribute something to Select2? **Here's how you can help.**
+
+Please take a moment to review this document in order to make the contribution
+process easy and effective for everyone involved.
+
+Following these guidelines helps to communicate that you respect the time of
+the developers managing and developing this open source project. In return,
+they should reciprocate that respect in addressing your issue or assessing
+patches and features.
+
+Using the issue tracker
+-----------------------
+When [reporting bugs][reporting-bugs] or
+[requesting features][requesting-features], the
+[issue tracker on GitHub][issue-tracker] is the recommended channel to use.
+
+The issue tracker **is not** a place for support requests. The
+[mailing list][mailing-list] or [IRC channel][irc-channel] are better places to
+get help.
+
+Reporting bugs with Select2
+---------------------------
+We really appreciate clear bug reports that _consistently_ show an issue
+_within Select2_.
+
+The ideal bug report follows these guidelines:
+
+1. **Use the [GitHub issue search][issue-search]**  &mdash; Check if the issue
+   has already been reported.
+2. **Check if the issue has been fixed**  &mdash; Try to reproduce the problem
+   using the code in the `master` branch.
+3. **Isolate the problem**  &mdash; Try to create an
+   [isolated test case][isolated-case] that consistently reproduces the problem.
+
+Please try to be as detailed as possible in your bug report, especially if an
+isolated test case cannot be made. Some useful questions to include the answer
+to are:
+
+- What steps can be used to reproduce the issue?
+- What is the bug and what is the expected outcome?
+- What browser(s) and Operating System have you tested with?
+- Does the bug happen consistently across all tested browsers?
+- What version of jQuery are you using? And what version of Select2?
+- Are you using Select2 with other plugins?
+
+All of these questions will help people fix and identify any potential bugs.
+
+Requesting features in Select2
+------------------------------
+Select2 is a large library that carries with it a lot of functionality. Because
+of this, many feature requests will not be implemented in the core library.
+
+Before starting work on a major feature for Select2, **contact the
+[community][community] first** or you may risk spending a considerable amount of
+time on something which the project developers are not interested in bringing
+into the project.
+
+### Select2 4.0
+
+Many feature requests will be closed off until 4.0, where Select2 plans to adopt
+a more flexible API.  If you are interested in helping with the development of
+the next major Select2 release, please send a message to the
+[mailing list][mailing-list] or [irc channel][irc-channel] for more information.
+
+Triaging issues and pull requests
+---------------------------------
+Anyone can help the project maintainers triage issues and review pull requests.
+
+### Handling new issues
+
+Select2 regularly receives new issues which need to be tested and organized.
+
+When a new issue that comes in that is similar to another existing issue, it
+should be checked to make sure it is not a duplicate.  Duplicates issues should
+be marked by replying to the issue with "Duplicate of #[issue number]" where
+`[issue number]` is the url or issue number for the existing issue.  This will
+allow the project maintainers to quickly close off additional issues and keep
+the discussion focused within a single issue.
+
+If you can test issues that are reported to Select2 that contain test cases and
+confirm under what conditions bugs happen, that will allow others to identify
+what causes a bug quicker.
+
+### Reviewing pull requests
+
+It is very common for pull requests to be opened for issues that contain a clear
+solution to the problem.  These pull requests should be rigorously reviewed by
+the community before being accepted.  If you are not sure about a piece of
+submitted code, or know of a better way to do something, do not hesitate to make
+a comment on the pull request.
+
+It should also be made clear that **all code contributed to Select** must be
+licensable under the [Apache 2 or GPL 2 licenses][licensing].  Code that cannot
+be released under either of these licenses **cannot be accepted** into the
+project.
+
+[community]: https://github.com/ivaynberg/select2#community
+[reporting-bugs]: #reporting-bugs-with-select2
+[requesting-features]: #requesting-features-in-select2
+[issue-tracker]: https://github.com/ivaynberg/select2/issues
+[mailing-list]: https://github.com/ivaynberg/select2#mailing-list
+[irc-channel]: https://github.com/ivaynberg/select2#irc-channel
+[issue-search]: https://github.com/ivaynberg/select2/search?q=&type=Issues
+[isolated-case]: http://css-tricks.com/6263-reduced-test-cases/
+[licensing]: https://github.com/ivaynberg/select2#copyright-and-license
diff --git a/core/assets/vendor/select2/LICENSE b/core/assets/vendor/select2/LICENSE
new file mode 100644
index 0000000..0247cc7
--- /dev/null
+++ b/core/assets/vendor/select2/LICENSE
@@ -0,0 +1,18 @@
+Copyright 2014 Igor Vaynberg
+
+Version: @@ver@@ Timestamp: @@timestamp@@
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License at:
+
+http://www.apache.org/licenses/LICENSE-2.0
+http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the Apache License
+or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
+either express or implied. See the Apache License and the GPL License for the specific language governing
+permissions and limitations under the Apache License and the GPL License.
diff --git a/core/assets/vendor/select2/README.md b/core/assets/vendor/select2/README.md
new file mode 100644
index 0000000..64380c4
--- /dev/null
+++ b/core/assets/vendor/select2/README.md
@@ -0,0 +1,114 @@
+Select2
+=======
+
+Select2 is a jQuery-based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.
+
+To get started, checkout examples and documentation at http://ivaynberg.github.com/select2
+
+Use cases
+---------
+
+* Enhancing native selects with search.
+* Enhancing native selects with a better multi-select interface.
+* Loading data from JavaScript: easily load items via ajax and have them searchable.
+* Nesting optgroups: native selects only support one level of nested. Select2 does not have this restriction.
+* Tagging: ability to add new items on the fly.
+* Working with large, remote datasets: ability to partially load a dataset based on the search term.
+* Paging of large datasets: easy support for loading more pages when the results are scrolled to the end.
+* Templating: support for custom rendering of results and selections.
+
+Browser compatibility
+---------------------
+* IE 8+
+* Chrome 8+
+* Firefox 10+
+* Safari 3+
+* Opera 10.6+
+
+Usage
+-----
+You can source Select2 directly from a CDN like [JSDliver](http://www.jsdelivr.com/#!select2) or [CDNJS](http://www.cdnjs.com/libraries/select2), [download it from this GitHub repo](https://github.com/ivaynberg/select2/tags), or use one of the integrations below.
+
+Integrations
+------------
+
+* [Wicket-Select2](https://github.com/ivaynberg/wicket-select2) (Java / [Apache Wicket](http://wicket.apache.org))
+* [select2-rails](https://github.com/argerim/select2-rails) (Ruby on Rails)
+* [AngularUI](http://angular-ui.github.io/#ui-select) ([AngularJS](https://angularjs.org/))
+* [Django](https://github.com/applegrew/django-select2)
+* [Symfony](https://github.com/19Gerhard85/sfSelect2WidgetsPlugin)
+* [Symfony2](https://github.com/avocode/FormExtensions)
+* [Bootstrap 2](https://github.com/t0m/select2-bootstrap-css) and [Bootstrap 3](https://github.com/t0m/select2-bootstrap-css/tree/bootstrap3) (CSS skins)
+* [Meteor](https://github.com/nate-strauser/meteor-select2) (modern reactive JavaScript framework; + [Bootstrap 3 skin](https://github.com/esperadomedia/meteor-select2-bootstrap3-css/))
+* [Meteor](https://jquery-select2.meteor.com)
+* [Yii 2.x](http://demos.krajee.com/widgets#select2)
+* [Yii 1.x](https://github.com/tonybolzan/yii-select2)
+* [AtmosphereJS](https://atmospherejs.com/package/jquery-select2)
+
+### Example Integrations
+
+* [Knockout.js](https://github.com/ivaynberg/select2/wiki/Knockout.js-Integration)
+* [Socket.IO](https://github.com/ivaynberg/select2/wiki/Socket.IO-Integration)
+* [PHP](https://github.com/ivaynberg/select2/wiki/PHP-Example)
+* [.Net MVC] (https://github.com/ivaynberg/select2/wiki/.Net-MVC-Example)
+
+Internationalization (i18n)
+---------------------------
+
+Select2 supports multiple languages by simply including the right language JS
+file (`select2_locale_it.js`, `select2_locale_nl.js`, etc.) after `select2.js`.
+
+Missing a language? Just copy `select2_locale_en.js.template`, translate
+it, and make a pull request back to Select2 here on GitHub.
+
+Documentation
+-------------
+
+The documentation for Select2 is available [through GitHub Pages](https://ivaynberg.github.io/select2/) and is located within this repository in the [`gh-pages` branch](https://github.com/ivaynberg/select2/tree/gh-pages).
+
+Community
+---------
+
+### Bug tracker
+
+Have a bug? Please create an issue here on GitHub!
+
+https://github.com/ivaynberg/select2/issues
+
+### Mailing list
+
+Have a question? Ask on our mailing list!
+
+select2@googlegroups.com
+
+https://groups.google.com/d/forum/select2
+
+### IRC channel
+
+Need help implementing Select2 in your project? Ask in our IRC channel!
+
+**Network:** [Freenode](https://freenode.net/) (`chat.freenode.net`)
+
+**Channel:** `#select2`
+
+**Web access:** https://webchat.freenode.net/?channels=select2
+
+Copyright and license
+---------------------
+
+Copyright 2012 Igor Vaynberg
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License in the LICENSE file, or at:
+
+http://www.apache.org/licenses/LICENSE-2.0
+http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the Apache License
+or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
+either express or implied. See the Apache License and the GPL License for the specific language governing
+permissions and limitations under the Apache License and the GPL License.
diff --git a/core/assets/vendor/select2/bower.json b/core/assets/vendor/select2/bower.json
new file mode 100644
index 0000000..54d44c4
--- /dev/null
+++ b/core/assets/vendor/select2/bower.json
@@ -0,0 +1,8 @@
+{
+    "name": "select2",
+    "version": "3.5.2",
+    "main": ["select2.js", "select2.css", "select2.png", "select2x2.png", "select2-spinner.gif"],
+    "dependencies": {
+        "jquery": ">= 1.7.1"
+    }
+}
diff --git a/core/assets/vendor/select2/component.json b/core/assets/vendor/select2/component.json
new file mode 100644
index 0000000..8bd3c02
--- /dev/null
+++ b/core/assets/vendor/select2/component.json
@@ -0,0 +1,66 @@
+{
+  "name": "select2",
+  "repo": "ivaynberg/select2",
+  "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
+  "version": "3.5.2",
+  "demo": "http://ivaynberg.github.io/select2/",
+  "keywords": [
+    "jquery"
+  ],
+  "main": "select2.js",
+  "styles": [
+    "select2.css",
+    "select2-bootstrap.css"
+  ],
+  "scripts": [
+    "select2.js",
+    "select2_locale_ar.js",
+    "select2_locale_bg.js",
+    "select2_locale_ca.js",
+    "select2_locale_cs.js",
+    "select2_locale_da.js",
+    "select2_locale_de.js",
+    "select2_locale_el.js",
+    "select2_locale_es.js",
+    "select2_locale_et.js",
+    "select2_locale_eu.js",
+    "select2_locale_fa.js",
+    "select2_locale_fi.js",
+    "select2_locale_fr.js",
+    "select2_locale_gl.js",
+    "select2_locale_he.js",
+    "select2_locale_hr.js",
+    "select2_locale_hu.js",
+    "select2_locale_id.js",
+    "select2_locale_is.js",
+    "select2_locale_it.js",
+    "select2_locale_ja.js",
+    "select2_locale_ka.js",
+    "select2_locale_ko.js",
+    "select2_locale_lt.js",
+    "select2_locale_lv.js",
+    "select2_locale_mk.js",
+    "select2_locale_ms.js",
+    "select2_locale_nl.js",
+    "select2_locale_no.js",
+    "select2_locale_pl.js",
+    "select2_locale_pt-BR.js",
+    "select2_locale_pt-PT.js",
+    "select2_locale_ro.js",
+    "select2_locale_ru.js",
+    "select2_locale_sk.js",
+    "select2_locale_sv.js",
+    "select2_locale_th.js",
+    "select2_locale_tr.js",
+    "select2_locale_uk.js",
+    "select2_locale_vi.js",
+    "select2_locale_zh-CN.js",
+    "select2_locale_zh-TW.js"
+  ],
+  "images": [
+    "select2-spinner.gif",
+    "select2.png",
+    "select2x2.png"
+  ],
+  "license": "MIT"
+}
diff --git a/core/assets/vendor/select2/composer.json b/core/assets/vendor/select2/composer.json
new file mode 100644
index 0000000..cd2d26a
--- /dev/null
+++ b/core/assets/vendor/select2/composer.json
@@ -0,0 +1,29 @@
+{
+  "name":
+  "ivaynberg/select2",
+  "description": "Select2 is a jQuery based replacement for select boxes.",
+  "version": "3.5.2",
+  "type": "component",
+  "homepage": "http://ivaynberg.github.io/select2/",
+  "license": "Apache-2.0",
+  "require": {
+    "robloach/component-installer": "*",
+    "components/jquery": ">=1.7.1"
+  },
+  "extra": {
+    "component": {
+      "scripts": [
+        "select2.js"
+      ],
+      "files": [
+        "select2.js",
+        "select2_locale_*.js",
+        "select2.css",
+        "select2-bootstrap.css",
+        "select2-spinner.gif",
+        "select2.png",
+        "select2x2.png"
+      ]
+    }
+  }
+}
diff --git a/core/assets/vendor/select2/package.json b/core/assets/vendor/select2/package.json
new file mode 100644
index 0000000..709cb1c
--- /dev/null
+++ b/core/assets/vendor/select2/package.json
@@ -0,0 +1,20 @@
+{
+  "name" : "Select2",
+  "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
+  "homepage": "http://ivaynberg.github.io/select2",
+  "author": "Igor Vaynberg",
+  "repository": {"type": "git", "url": "git://github.com/ivaynberg/select2.git"},
+  "main": "select2.js",
+  "version": "3.5.2",
+  "jspm": {
+    "main": "select2",
+    "files": ["select2.js", "select2.png", "select2.css", "select2-spinner.gif"],
+    "shim": {
+        "select2": {
+            "imports": ["jquery", "./select2.css!"],
+            "exports": "$"
+        }
+    },
+    "buildConfig": { "uglify": true }
+  }
+}
diff --git a/core/assets/vendor/select2/release.sh b/core/assets/vendor/select2/release.sh
new file mode 100755
index 0000000..3b63f96
--- /dev/null
+++ b/core/assets/vendor/select2/release.sh
@@ -0,0 +1,79 @@
+#!/bin/bash
+set -e
+
+echo -n "Enter the version for this release: "
+
+read ver
+
+if [ ! $ver ]; then
+	echo "Invalid version."
+	exit
+fi
+
+name="select2"
+js="$name.js"
+mini="$name.min.js"
+css="$name.css"
+release="$name-$ver"
+tag="$ver"
+branch="build-$ver"
+curbranch=`git branch | grep "*" | sed "s/* //"`
+timestamp=$(date)
+tokens="s/@@ver@@/$ver/g;s/\@@timestamp@@/$timestamp/g"
+remote="origin"
+
+echo "Pulling from origin"
+
+git pull
+
+echo "Updating Version Identifiers"
+
+sed -E -e "s/\"version\": \"([0-9\.]+)\",/\"version\": \"$ver\",/g" -i -- bower.json select2.jquery.json component.json composer.json package.json
+
+git add bower.json
+git add select2.jquery.json
+git add component.json
+git add composer.json
+git add package.json
+
+git commit -m "modified version identifiers in descriptors for release $ver"
+git push
+
+git branch "$branch"
+git checkout "$branch"
+
+echo "Tokenizing..."
+
+find . -name "$js" | xargs -I{} sed -e "$tokens" -i -- {}
+find . -name "$css" | xargs -I{} sed -e "$tokens" -i -- {}
+
+sed -e "s/latest/$ver/g" -i -- bower.json
+
+git add "$js"
+git add "$css"
+
+echo "Minifying..."
+
+echo "/*" > "$mini"
+cat LICENSE | sed "$tokens" >> "$mini"
+echo "*/" >> "$mini"
+
+curl -s \
+	--data-urlencode "js_code@$js" \
+	http://marijnhaverbeke.nl/uglifyjs \
+	>> "$mini"
+
+git add "$mini"
+
+git commit -m "release $ver"
+
+echo "Tagging..."
+git tag -a "$tag" -m "tagged version $ver"
+git push "$remote" --tags
+
+echo "Cleaning Up..."
+
+git checkout "$curbranch"
+git branch -D "$branch"
+
+echo "Done"
diff --git a/core/assets/vendor/select2/select2-bootstrap.css b/core/assets/vendor/select2/select2-bootstrap.css
new file mode 100644
index 0000000..3b83f0a
--- /dev/null
+++ b/core/assets/vendor/select2/select2-bootstrap.css
@@ -0,0 +1,87 @@
+.form-control .select2-choice {
+    border: 0;
+    border-radius: 2px;
+}
+
+.form-control .select2-choice .select2-arrow {
+    border-radius: 0 2px 2px 0;   
+}
+
+.form-control.select2-container {
+    height: auto !important;
+    padding: 0;
+}
+
+.form-control.select2-container.select2-dropdown-open {
+    border-color: #5897FB;
+    border-radius: 3px 3px 0 0;
+}
+
+.form-control .select2-container.select2-dropdown-open .select2-choices {
+    border-radius: 3px 3px 0 0;
+}
+
+.form-control.select2-container .select2-choices {
+    border: 0 !important;
+    border-radius: 3px;
+}
+
+.control-group.warning .select2-container .select2-choice,
+.control-group.warning .select2-container .select2-choices,
+.control-group.warning .select2-container-active .select2-choice,
+.control-group.warning .select2-container-active .select2-choices,
+.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice,
+.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices,
+.control-group.warning .select2-container-multi.select2-container-active .select2-choices {
+    border: 1px solid #C09853 !important;
+}
+
+.control-group.warning .select2-container .select2-choice div {
+    border-left: 1px solid #C09853 !important;
+    background: #FCF8E3 !important;
+}
+
+.control-group.error .select2-container .select2-choice,
+.control-group.error .select2-container .select2-choices,
+.control-group.error .select2-container-active .select2-choice,
+.control-group.error .select2-container-active .select2-choices,
+.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice,
+.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices,
+.control-group.error .select2-container-multi.select2-container-active .select2-choices {
+    border: 1px solid #B94A48 !important;
+}
+
+.control-group.error .select2-container .select2-choice div {
+    border-left: 1px solid #B94A48 !important;
+    background: #F2DEDE !important;
+}
+
+.control-group.info .select2-container .select2-choice,
+.control-group.info .select2-container .select2-choices,
+.control-group.info .select2-container-active .select2-choice,
+.control-group.info .select2-container-active .select2-choices,
+.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice,
+.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices,
+.control-group.info .select2-container-multi.select2-container-active .select2-choices {
+    border: 1px solid #3A87AD !important;
+}
+
+.control-group.info .select2-container .select2-choice div {
+    border-left: 1px solid #3A87AD !important;
+    background: #D9EDF7 !important;
+}
+
+.control-group.success .select2-container .select2-choice,
+.control-group.success .select2-container .select2-choices,
+.control-group.success .select2-container-active .select2-choice,
+.control-group.success .select2-container-active .select2-choices,
+.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice,
+.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices,
+.control-group.success .select2-container-multi.select2-container-active .select2-choices {
+    border: 1px solid #468847 !important;
+}
+
+.control-group.success .select2-container .select2-choice div {
+    border-left: 1px solid #468847 !important;
+    background: #DFF0D8 !important;
+}
diff --git a/core/assets/vendor/select2/select2-spinner.gif b/core/assets/vendor/select2/select2-spinner.gif
new file mode 100644
index 0000000..5b33f7e
--- /dev/null
+++ b/core/assets/vendor/select2/select2-spinner.gif
@@ -0,0 +1,32 @@
+GIF89a       FFFzzz   XXX$$$666hhh                                             !NETSCAPE2.0   !Created with ajaxload.info !	
+   ,       w  	!DBAH¬aD@ ^AXP@"UQ#	B\;1o:2$v@
+$|,3
+_# d53"s5e! !	
+   ,       v  i@e9DAA/`ph$Ca%@ pHxFuSx#.݄YfL_"
+p
+3BW]|L\6{|z87[7! !	
+   ,       x  e9DE"2r,qP j`8@8bH, *0-mFW9LPE3+
+(B"f{*BW_/@_$~Kr7Ar7! !	
+   ,       v  4e9!H"*Q/@-4ép4R+-pȧ`P(6᠝U/ 	*,)(+/]"lO/*AkK]A~666! !	
+   ,       l  ie9"* -80H=N;TEqeUoK2_WZ݌V1jgWe@tuH//w`?f~#6#! !	
+   ,       ~  ,e9"*
+;pR%#0` 'c(J@@/1i4`VBVu}"caNi/]))- Lel	mi} me[+! !	
+   ,       y  Ie9"M6*¨"7E͖@G((L&pqj@Z %@wZ) pl(
+ԭqu*R&c	`))(s_J>_\'Gm7$+! !	
+   ,       w  Ie9*, (*(B5[1 ZIah!GexzJ0e6@V|U4Dm%$͛p
+	\G x		} @+|=+
+1-	Ea5l)+! !	
+   ,       y  )䨞'AKڍ,E\(l&;5 5D03a0--ÃpH4V	%i
+p[R"|	#
+	6iZwcw*! !	
+   ,       y  )䨞,K*0a;׋аY8b`4n¨Bb bx,(	Ƚ %
+>
+2*i*	/:+$v*! !	
+   ,       u  )䨞l[$
+Jq[q3`Q[5:IX!0rAD8CvHPfii QAP@pC%D PQ46iciNj0w)#! !	
+   ,       y  ).q
+,GJ r(J8C*B,&<
+hW~-`,	,>;
+8RN<,<1T]
+c'qk$
+@)#! ;         
\ No newline at end of file
diff --git a/core/assets/vendor/select2/select2.css b/core/assets/vendor/select2/select2.css
new file mode 100644
index 0000000..2d07a03
--- /dev/null
+++ b/core/assets/vendor/select2/select2.css
@@ -0,0 +1,704 @@
+/*
+Version: 3.5.2 Timestamp: Sat Nov  1 14:43:36 EDT 2014
+*/
+.select2-container {
+    margin: 0;
+    position: relative;
+    display: inline-block;
+    /* inline-block for ie7 */
+    zoom: 1;
+    *display: inline;
+    vertical-align: middle;
+}
+
+.select2-container,
+.select2-drop,
+.select2-search,
+.select2-search input {
+  /*
+    Force border-box so that % widths fit the parent
+    container without overlap because of margin/padding.
+    More Info : http://www.quirksmode.org/css/box.html
+  */
+  -webkit-box-sizing: border-box; /* webkit */
+     -moz-box-sizing: border-box; /* firefox */
+          box-sizing: border-box; /* css3 */
+}
+
+.select2-container .select2-choice {
+    display: block;
+    height: 26px;
+    padding: 0 0 0 8px;
+    overflow: hidden;
+    position: relative;
+
+    border: 1px solid #aaa;
+    white-space: nowrap;
+    line-height: 26px;
+    color: #444;
+    text-decoration: none;
+
+    border-radius: 4px;
+
+    background-clip: padding-box;
+
+    -webkit-touch-callout: none;
+      -webkit-user-select: none;
+         -moz-user-select: none;
+          -ms-user-select: none;
+              user-select: none;
+
+    background-color: #fff;
+    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
+    background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
+    background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
+    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
+    background-image: linear-gradient(to top, #eee 0%, #fff 50%);
+}
+
+html[dir="rtl"] .select2-container .select2-choice {
+    padding: 0 8px 0 0;
+}
+
+.select2-container.select2-drop-above .select2-choice {
+    border-bottom-color: #aaa;
+
+    border-radius: 0 0 4px 4px;
+
+    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
+    background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
+    background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
+    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
+    background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
+}
+
+.select2-container.select2-allowclear .select2-choice .select2-chosen {
+    margin-right: 42px;
+}
+
+.select2-container .select2-choice > .select2-chosen {
+    margin-right: 26px;
+    display: block;
+    overflow: hidden;
+
+    white-space: nowrap;
+
+    text-overflow: ellipsis;
+    float: none;
+    width: auto;
+}
+
+html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
+    margin-left: 26px;
+    margin-right: 0;
+}
+
+.select2-container .select2-choice abbr {
+    display: none;
+    width: 12px;
+    height: 12px;
+    position: absolute;
+    right: 24px;
+    top: 8px;
+
+    font-size: 1px;
+    text-decoration: none;
+
+    border: 0;
+    background: url('select2.png') right top no-repeat;
+    cursor: pointer;
+    outline: 0;
+}
+
+.select2-container.select2-allowclear .select2-choice abbr {
+    display: inline-block;
+}
+
+.select2-container .select2-choice abbr:hover {
+    background-position: right -11px;
+    cursor: pointer;
+}
+
+.select2-drop-mask {
+    border: 0;
+    margin: 0;
+    padding: 0;
+    position: fixed;
+    left: 0;
+    top: 0;
+    min-height: 100%;
+    min-width: 100%;
+    height: auto;
+    width: auto;
+    opacity: 0;
+    z-index: 9998;
+    /* styles required for IE to work */
+    background-color: #fff;
+    filter: alpha(opacity=0);
+}
+
+.select2-drop {
+    width: 100%;
+    margin-top: -1px;
+    position: absolute;
+    z-index: 9999;
+    top: 100%;
+
+    background: #fff;
+    color: #000;
+    border: 1px solid #aaa;
+    border-top: 0;
+
+    border-radius: 0 0 4px 4px;
+
+    -webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
+            box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
+}
+
+.select2-drop.select2-drop-above {
+    margin-top: 1px;
+    border-top: 1px solid #aaa;
+    border-bottom: 0;
+
+    border-radius: 4px 4px 0 0;
+
+    -webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
+            box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
+}
+
+.select2-drop-active {
+    border: 1px solid #5897fb;
+    border-top: none;
+}
+
+.select2-drop.select2-drop-above.select2-drop-active {
+    border-top: 1px solid #5897fb;
+}
+
+.select2-drop-auto-width {
+    border-top: 1px solid #aaa;
+    width: auto;
+}
+
+.select2-drop-auto-width .select2-search {
+    padding-top: 4px;
+}
+
+.select2-container .select2-choice .select2-arrow {
+    display: inline-block;
+    width: 18px;
+    height: 100%;
+    position: absolute;
+    right: 0;
+    top: 0;
+
+    border-left: 1px solid #aaa;
+    border-radius: 0 4px 4px 0;
+
+    background-clip: padding-box;
+
+    background: #ccc;
+    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
+    background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
+    background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
+    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
+    background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
+}
+
+html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
+    left: 0;
+    right: auto;
+
+    border-left: none;
+    border-right: 1px solid #aaa;
+    border-radius: 4px 0 0 4px;
+}
+
+.select2-container .select2-choice .select2-arrow b {
+    display: block;
+    width: 100%;
+    height: 100%;
+    background: url('select2.png') no-repeat 0 1px;
+}
+
+html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
+    background-position: 2px 1px;
+}
+
+.select2-search {
+    display: inline-block;
+    width: 100%;
+    min-height: 26px;
+    margin: 0;
+    padding-left: 4px;
+    padding-right: 4px;
+
+    position: relative;
+    z-index: 10000;
+
+    white-space: nowrap;
+}
+
+.select2-search input {
+    width: 100%;
+    height: auto !important;
+    min-height: 26px;
+    padding: 4px 20px 4px 5px;
+    margin: 0;
+
+    outline: 0;
+    font-family: sans-serif;
+    font-size: 1em;
+
+    border: 1px solid #aaa;
+    border-radius: 0;
+
+    -webkit-box-shadow: none;
+            box-shadow: none;
+
+    background: #fff url('select2.png') no-repeat 100% -22px;
+    background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
+    background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
+    background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
+    background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
+}
+
+html[dir="rtl"] .select2-search input {
+    padding: 4px 5px 4px 20px;
+
+    background: #fff url('select2.png') no-repeat -37px -22px;
+    background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
+    background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
+    background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
+    background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
+}
+
+.select2-drop.select2-drop-above .select2-search input {
+    margin-top: 4px;
+}
+
+.select2-search input.select2-active {
+    background: #fff url('select2-spinner.gif') no-repeat 100%;
+    background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
+    background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
+    background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
+    background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
+}
+
+.select2-container-active .select2-choice,
+.select2-container-active .select2-choices {
+    border: 1px solid #5897fb;
+    outline: none;
+
+    -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
+            box-shadow: 0 0 5px rgba(0, 0, 0, .3);
+}
+
+.select2-dropdown-open .select2-choice {
+    border-bottom-color: transparent;
+    -webkit-box-shadow: 0 1px 0 #fff inset;
+            box-shadow: 0 1px 0 #fff inset;
+
+    border-bottom-left-radius: 0;
+    border-bottom-right-radius: 0;
+
+    background-color: #eee;
+    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
+    background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
+    background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
+    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
+    background-image: linear-gradient(to top, #fff 0%, #eee 50%);
+}
+
+.select2-dropdown-open.select2-drop-above .select2-choice,
+.select2-dropdown-open.select2-drop-above .select2-choices {
+    border: 1px solid #5897fb;
+    border-top-color: transparent;
+
+    background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
+    background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
+    background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
+    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
+    background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
+}
+
+.select2-dropdown-open .select2-choice .select2-arrow {
+    background: transparent;
+    border-left: none;
+    filter: none;
+}
+html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
+    border-right: none;
+}
+
+.select2-dropdown-open .select2-choice .select2-arrow b {
+    background-position: -18px 1px;
+}
+
+html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
+    background-position: -16px 1px;
+}
+
+.select2-hidden-accessible {
+    border: 0;
+    clip: rect(0 0 0 0);
+    height: 1px;
+    margin: -1px;
+    overflow: hidden;
+    padding: 0;
+    position: absolute;
+    width: 1px;
+}
+
+/* results */
+.select2-results {
+    max-height: 200px;
+    padding: 0 0 0 4px;
+    margin: 4px 4px 4px 0;
+    position: relative;
+    overflow-x: hidden;
+    overflow-y: auto;
+    -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
+}
+
+html[dir="rtl"] .select2-results {
+    padding: 0 4px 0 0;
+    margin: 4px 0 4px 4px;
+}
+
+.select2-results ul.select2-result-sub {
+    margin: 0;
+    padding-left: 0;
+}
+
+.select2-results li {
+    list-style: none;
+    display: list-item;
+    background-image: none;
+}
+
+.select2-results li.select2-result-with-children > .select2-result-label {
+    font-weight: bold;
+}
+
+.select2-results .select2-result-label {
+    padding: 3px 7px 4px;
+    margin: 0;
+    cursor: pointer;
+
+    min-height: 1em;
+
+    -webkit-touch-callout: none;
+      -webkit-user-select: none;
+         -moz-user-select: none;
+          -ms-user-select: none;
+              user-select: none;
+}
+
+.select2-results-dept-1 .select2-result-label { padding-left: 20px }
+.select2-results-dept-2 .select2-result-label { padding-left: 40px }
+.select2-results-dept-3 .select2-result-label { padding-left: 60px }
+.select2-results-dept-4 .select2-result-label { padding-left: 80px }
+.select2-results-dept-5 .select2-result-label { padding-left: 100px }
+.select2-results-dept-6 .select2-result-label { padding-left: 110px }
+.select2-results-dept-7 .select2-result-label { padding-left: 120px }
+
+.select2-results .select2-highlighted {
+    background: #3875d7;
+    color: #fff;
+}
+
+.select2-results li em {
+    background: #feffde;
+    font-style: normal;
+}
+
+.select2-results .select2-highlighted em {
+    background: transparent;
+}
+
+.select2-results .select2-highlighted ul {
+    background: #fff;
+    color: #000;
+}
+
+.select2-results .select2-no-results,
+.select2-results .select2-searching,
+.select2-results .select2-ajax-error,
+.select2-results .select2-selection-limit {
+    background: #f4f4f4;
+    display: list-item;
+    padding-left: 5px;
+}
+
+/*
+disabled look for disabled choices in the results dropdown
+*/
+.select2-results .select2-disabled.select2-highlighted {
+    color: #666;
+    background: #f4f4f4;
+    display: list-item;
+    cursor: default;
+}
+.select2-results .select2-disabled {
+  background: #f4f4f4;
+  display: list-item;
+  cursor: default;
+}
+
+.select2-results .select2-selected {
+    display: none;
+}
+
+.select2-more-results.select2-active {
+    background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
+}
+
+.select2-results .select2-ajax-error {
+    background: rgba(255, 50, 50, .2);
+}
+
+.select2-more-results {
+    background: #f4f4f4;
+    display: list-item;
+}
+
+/* disabled styles */
+
+.select2-container.select2-container-disabled .select2-choice {
+    background-color: #f4f4f4;
+    background-image: none;
+    border: 1px solid #ddd;
+    cursor: default;
+}
+
+.select2-container.select2-container-disabled .select2-choice .select2-arrow {
+    background-color: #f4f4f4;
+    background-image: none;
+    border-left: 0;
+}
+
+.select2-container.select2-container-disabled .select2-choice abbr {
+    display: none;
+}
+
+
+/* multiselect */
+
+.select2-container-multi .select2-choices {
+    height: auto !important;
+    height: 1%;
+    margin: 0;
+    padding: 0 5px 0 0;
+    position: relative;
+
+    border: 1px solid #aaa;
+    cursor: text;
+    overflow: hidden;
+
+    background-color: #fff;
+    background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
+    background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
+    background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
+    background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
+}
+
+html[dir="rtl"] .select2-container-multi .select2-choices {
+    padding: 0 0 0 5px;
+}
+
+.select2-locked {
+  padding: 3px 5px 3px 5px !important;
+}
+
+.select2-container-multi .select2-choices {
+    min-height: 26px;
+}
+
+.select2-container-multi.select2-container-active .select2-choices {
+    border: 1px solid #5897fb;
+    outline: none;
+
+    -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
+            box-shadow: 0 0 5px rgba(0, 0, 0, .3);
+}
+.select2-container-multi .select2-choices li {
+    float: left;
+    list-style: none;
+}
+html[dir="rtl"] .select2-container-multi .select2-choices li
+{
+    float: right;
+}
+.select2-container-multi .select2-choices .select2-search-field {
+    margin: 0;
+    padding: 0;
+    white-space: nowrap;
+}
+
+.select2-container-multi .select2-choices .select2-search-field input {
+    padding: 5px;
+    margin: 1px 0;
+
+    font-family: sans-serif;
+    font-size: 100%;
+    color: #666;
+    outline: 0;
+    border: 0;
+    -webkit-box-shadow: none;
+            box-shadow: none;
+    background: transparent !important;
+}
+
+.select2-container-multi .select2-choices .select2-search-field input.select2-active {
+    background: #fff url('select2-spinner.gif') no-repeat 100% !important;
+}
+
+.select2-default {
+    color: #999 !important;
+}
+
+.select2-container-multi .select2-choices .select2-search-choice {
+    padding: 3px 5px 3px 18px;
+    margin: 3px 0 3px 5px;
+    position: relative;
+
+    line-height: 13px;
+    color: #333;
+    cursor: default;
+    border: 1px solid #aaaaaa;
+
+    border-radius: 3px;
+
+    -webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
+            box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
+
+    background-clip: padding-box;
+
+    -webkit-touch-callout: none;
+      -webkit-user-select: none;
+         -moz-user-select: none;
+          -ms-user-select: none;
+              user-select: none;
+
+    background-color: #e4e4e4;
+    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
+    background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
+    background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
+    background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
+    background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
+}
+html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
+{
+    margin: 3px 5px 3px 0;
+    padding: 3px 18px 3px 5px;
+}
+.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
+    cursor: default;
+}
+.select2-container-multi .select2-choices .select2-search-choice-focus {
+    background: #d4d4d4;
+}
+
+.select2-search-choice-close {
+    display: block;
+    width: 12px;
+    height: 13px;
+    position: absolute;
+    right: 3px;
+    top: 4px;
+
+    font-size: 1px;
+    outline: none;
+    background: url('select2.png') right top no-repeat;
+}
+html[dir="rtl"] .select2-search-choice-close {
+    right: auto;
+    left: 3px;
+}
+
+.select2-container-multi .select2-search-choice-close {
+    left: 3px;
+}
+
+html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
+    left: auto;
+    right: 2px;
+}
+
+.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
+  background-position: right -11px;
+}
+.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
+    background-position: right -11px;
+}
+
+/* disabled styles */
+.select2-container-multi.select2-container-disabled .select2-choices {
+    background-color: #f4f4f4;
+    background-image: none;
+    border: 1px solid #ddd;
+    cursor: default;
+}
+
+.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
+    padding: 3px 5px 3px 5px;
+    border: 1px solid #ddd;
+    background-image: none;
+    background-color: #f4f4f4;
+}
+
+.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close {    display: none;
+    background: none;
+}
+/* end multiselect */
+
+
+.select2-result-selectable .select2-match,
+.select2-result-unselectable .select2-match {
+    text-decoration: underline;
+}
+
+.select2-offscreen, .select2-offscreen:focus {
+    clip: rect(0 0 0 0) !important;
+    width: 1px !important;
+    height: 1px !important;
+    border: 0 !important;
+    margin: 0 !important;
+    padding: 0 !important;
+    overflow: hidden !important;
+    position: absolute !important;
+    outline: 0 !important;
+    left: 0px !important;
+    top: 0px !important;
+}
+
+.select2-display-none {
+    display: none;
+}
+
+.select2-measure-scrollbar {
+    position: absolute;
+    top: -10000px;
+    left: -10000px;
+    width: 100px;
+    height: 100px;
+    overflow: scroll;
+}
+
+/* Retina-ize icons */
+
+@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx)  {
+    .select2-search input,
+    .select2-search-choice-close,
+    .select2-container .select2-choice abbr,
+    .select2-container .select2-choice .select2-arrow b {
+        background-image: url('select2x2.png') !important;
+        background-repeat: no-repeat !important;
+        background-size: 60px 40px !important;
+    }
+
+    .select2-search input {
+        background-position: 100% -21px !important;
+    }
+}
diff --git a/core/assets/vendor/select2/select2.jquery.json b/core/assets/vendor/select2/select2.jquery.json
new file mode 100644
index 0000000..b005d8a
--- /dev/null
+++ b/core/assets/vendor/select2/select2.jquery.json
@@ -0,0 +1,36 @@
+{
+    "name": "select2",
+    "title": "Select2",
+    "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
+    "keywords": [
+        "select",
+        "autocomplete",
+        "typeahead",
+        "dropdown",
+        "multiselect",
+        "tag",
+        "tagging"
+    ],
+    "version": "3.5.2",
+    "author": {
+        "name": "Igor Vaynberg",
+        "url": "https://github.com/ivaynberg"
+    },
+    "licenses": [
+        {
+            "type": "Apache",
+            "url": "http://www.apache.org/licenses/LICENSE-2.0"
+        },
+        {
+            "type": "GPL v2",
+            "url": "http://www.gnu.org/licenses/gpl-2.0.html"
+        }
+    ],
+    "bugs": "https://github.com/ivaynberg/select2/issues",
+    "homepage": "http://ivaynberg.github.com/select2",
+    "docs": "http://ivaynberg.github.com/select2/",
+    "download": "https://github.com/ivaynberg/select2/tags",
+    "dependencies": {
+        "jquery": ">=1.7.1"
+    }
+}
diff --git a/core/assets/vendor/select2/select2.js b/core/assets/vendor/select2/select2.js
new file mode 100644
index 0000000..7590b82
--- /dev/null
+++ b/core/assets/vendor/select2/select2.js
@@ -0,0 +1,3541 @@
+/*
+Copyright 2012 Igor Vaynberg
+
+Version: 3.5.2 Timestamp: Sat Nov  1 14:43:36 EDT 2014
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License at:
+
+    http://www.apache.org/licenses/LICENSE-2.0
+    http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the
+Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
+CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
+the specific language governing permissions and limitations under the Apache License and the GPL License.
+*/
+(function ($) {
+    if(typeof $.fn.each2 == "undefined") {
+        $.extend($.fn, {
+            /*
+            * 4-10 times faster .each replacement
+            * use it carefully, as it overrides jQuery context of element on each iteration
+            */
+            each2 : function (c) {
+                var j = $([0]), i = -1, l = this.length;
+                while (
+                    ++i < l
+                    && (j.context = j[0] = this[i])
+                    && c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
+                );
+                return this;
+            }
+        });
+    }
+})(jQuery);
+
+(function ($, undefined) {
+    "use strict";
+    /*global document, window, jQuery, console */
+
+    if (window.Select2 !== undefined) {
+        return;
+    }
+
+    var AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
+        lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
+
+    KEY = {
+        TAB: 9,
+        ENTER: 13,
+        ESC: 27,
+        SPACE: 32,
+        LEFT: 37,
+        UP: 38,
+        RIGHT: 39,
+        DOWN: 40,
+        SHIFT: 16,
+        CTRL: 17,
+        ALT: 18,
+        PAGE_UP: 33,
+        PAGE_DOWN: 34,
+        HOME: 36,
+        END: 35,
+        BACKSPACE: 8,
+        DELETE: 46,
+        isArrow: function (k) {
+            k = k.which ? k.which : k;
+            switch (k) {
+            case KEY.LEFT:
+            case KEY.RIGHT:
+            case KEY.UP:
+            case KEY.DOWN:
+                return true;
+            }
+            return false;
+        },
+        isControl: function (e) {
+            var k = e.which;
+            switch (k) {
+            case KEY.SHIFT:
+            case KEY.CTRL:
+            case KEY.ALT:
+                return true;
+            }
+
+            if (e.metaKey) return true;
+
+            return false;
+        },
+        isFunctionKey: function (k) {
+            k = k.which ? k.which : k;
+            return k >= 112 && k <= 123;
+        }
+    },
+    MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
+
+    DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
+
+    $document = $(document);
+
+    nextUid=(function() { var counter=1; return function() { return counter++; }; }());
+
+
+    function reinsertElement(element) {
+        var placeholder = $(document.createTextNode(''));
+
+        element.before(placeholder);
+        placeholder.before(element);
+        placeholder.remove();
+    }
+
+    function stripDiacritics(str) {
+        // Used 'uni range + named function' from http://jsperf.com/diacritics/18
+        function match(a) {
+            return DIACRITICS[a] || a;
+        }
+
+        return str.replace(/[^\u0000-\u007E]/g, match);
+    }
+
+    function indexOf(value, array) {
+        var i = 0, l = array.length;
+        for (; i < l; i = i + 1) {
+            if (equal(value, array[i])) return i;
+        }
+        return -1;
+    }
+
+    function measureScrollbar () {
+        var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
+        $template.appendTo(document.body);
+
+        var dim = {
+            width: $template.width() - $template[0].clientWidth,
+            height: $template.height() - $template[0].clientHeight
+        };
+        $template.remove();
+
+        return dim;
+    }
+
+    /**
+     * Compares equality of a and b
+     * @param a
+     * @param b
+     */
+    function equal(a, b) {
+        if (a === b) return true;
+        if (a === undefined || b === undefined) return false;
+        if (a === null || b === null) return false;
+        // Check whether 'a' or 'b' is a string (primitive or object).
+        // The concatenation of an empty string (+'') converts its argument to a string's primitive.
+        if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
+        if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
+        return false;
+    }
+
+    /**
+     * Splits the string into an array of values, transforming each value. An empty array is returned for nulls or empty
+     * strings
+     * @param string
+     * @param separator
+     */
+    function splitVal(string, separator, transform) {
+        var val, i, l;
+        if (string === null || string.length < 1) return [];
+        val = string.split(separator);
+        for (i = 0, l = val.length; i < l; i = i + 1) val[i] = transform(val[i]);
+        return val;
+    }
+
+    function getSideBorderPadding(element) {
+        return element.outerWidth(false) - element.width();
+    }
+
+    function installKeyUpChangeEvent(element) {
+        var key="keyup-change-value";
+        element.on("keydown", function () {
+            if ($.data(element, key) === undefined) {
+                $.data(element, key, element.val());
+            }
+        });
+        element.on("keyup", function () {
+            var val= $.data(element, key);
+            if (val !== undefined && element.val() !== val) {
+                $.removeData(element, key);
+                element.trigger("keyup-change");
+            }
+        });
+    }
+
+
+    /**
+     * filters mouse events so an event is fired only if the mouse moved.
+     *
+     * filters out mouse events that occur when mouse is stationary but
+     * the elements under the pointer are scrolled.
+     */
+    function installFilteredMouseMove(element) {
+        element.on("mousemove", function (e) {
+            var lastpos = lastMousePosition;
+            if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
+                $(e.target).trigger("mousemove-filtered", e);
+            }
+        });
+    }
+
+    /**
+     * Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
+     * within the last quietMillis milliseconds.
+     *
+     * @param quietMillis number of milliseconds to wait before invoking fn
+     * @param fn function to be debounced
+     * @param ctx object to be used as this reference within fn
+     * @return debounced version of fn
+     */
+    function debounce(quietMillis, fn, ctx) {
+        ctx = ctx || undefined;
+        var timeout;
+        return function () {
+            var args = arguments;
+            window.clearTimeout(timeout);
+            timeout = window.setTimeout(function() {
+                fn.apply(ctx, args);
+            }, quietMillis);
+        };
+    }
+
+    function installDebouncedScroll(threshold, element) {
+        var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
+        element.on("scroll", function (e) {
+            if (indexOf(e.target, element.get()) >= 0) notify(e);
+        });
+    }
+
+    function focus($el) {
+        if ($el[0] === document.activeElement) return;
+
+        /* set the focus in a 0 timeout - that way the focus is set after the processing
+            of the current event has finished - which seems like the only reliable way
+            to set focus */
+        window.setTimeout(function() {
+            var el=$el[0], pos=$el.val().length, range;
+
+            $el.focus();
+
+            /* make sure el received focus so we do not error out when trying to manipulate the caret.
+                sometimes modals or others listeners may steal it after its set */
+            var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0);
+            if (isVisible && el === document.activeElement) {
+
+                /* after the focus is set move the caret to the end, necessary when we val()
+                    just before setting focus */
+                if(el.setSelectionRange)
+                {
+                    el.setSelectionRange(pos, pos);
+                }
+                else if (el.createTextRange) {
+                    range = el.createTextRange();
+                    range.collapse(false);
+                    range.select();
+                }
+            }
+        }, 0);
+    }
+
+    function getCursorInfo(el) {
+        el = $(el)[0];
+        var offset = 0;
+        var length = 0;
+        if ('selectionStart' in el) {
+            offset = el.selectionStart;
+            length = el.selectionEnd - offset;
+        } else if ('selection' in document) {
+            el.focus();
+            var sel = document.selection.createRange();
+            length = document.selection.createRange().text.length;
+            sel.moveStart('character', -el.value.length);
+            offset = sel.text.length - length;
+        }
+        return { offset: offset, length: length };
+    }
+
+    function killEvent(event) {
+        event.preventDefault();
+        event.stopPropagation();
+    }
+    function killEventImmediately(event) {
+        event.preventDefault();
+        event.stopImmediatePropagation();
+    }
+
+    function measureTextWidth(e) {
+        if (!sizer){
+            var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
+            sizer = $(document.createElement("div")).css({
+                position: "absolute",
+                left: "-10000px",
+                top: "-10000px",
+                display: "none",
+                fontSize: style.fontSize,
+                fontFamily: style.fontFamily,
+                fontStyle: style.fontStyle,
+                fontWeight: style.fontWeight,
+                letterSpacing: style.letterSpacing,
+                textTransform: style.textTransform,
+                whiteSpace: "nowrap"
+            });
+            sizer.attr("class","select2-sizer");
+            $(document.body).append(sizer);
+        }
+        sizer.text(e.val());
+        return sizer.width();
+    }
+
+    function syncCssClasses(dest, src, adapter) {
+        var classes, replacements = [], adapted;
+
+        classes = $.trim(dest.attr("class"));
+
+        if (classes) {
+            classes = '' + classes; // for IE which returns object
+
+            $(classes.split(/\s+/)).each2(function() {
+                if (this.indexOf("select2-") === 0) {
+                    replacements.push(this);
+                }
+            });
+        }
+
+        classes = $.trim(src.attr("class"));
+
+        if (classes) {
+            classes = '' + classes; // for IE which returns object
+
+            $(classes.split(/\s+/)).each2(function() {
+                if (this.indexOf("select2-") !== 0) {
+                    adapted = adapter(this);
+
+                    if (adapted) {
+                        replacements.push(adapted);
+                    }
+                }
+            });
+        }
+
+        dest.attr("class", replacements.join(" "));
+    }
+
+
+    function markMatch(text, term, markup, escapeMarkup) {
+        var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
+            tl=term.length;
+
+        if (match<0) {
+            markup.push(escapeMarkup(text));
+            return;
+        }
+
+        markup.push(escapeMarkup(text.substring(0, match)));
+        markup.push("<span class='select2-match'>");
+        markup.push(escapeMarkup(text.substring(match, match + tl)));
+        markup.push("</span>");
+        markup.push(escapeMarkup(text.substring(match + tl, text.length)));
+    }
+
+    function defaultEscapeMarkup(markup) {
+        var replace_map = {
+            '\\': '&#92;',
+            '&': '&amp;',
+            '<': '&lt;',
+            '>': '&gt;',
+            '"': '&quot;',
+            "'": '&#39;',
+            "/": '&#47;'
+        };
+
+        return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
+            return replace_map[match];
+        });
+    }
+
+    /**
+     * Produces an ajax-based query function
+     *
+     * @param options object containing configuration parameters
+     * @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
+     * @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
+     * @param options.url url for the data
+     * @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
+     * @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
+     * @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
+     * @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
+     *      The expected format is an object containing the following keys:
+     *      results array of objects that will be used as choices
+     *      more (optional) boolean indicating whether there are more results available
+     *      Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
+     */
+    function ajax(options) {
+        var timeout, // current scheduled but not yet executed request
+            handler = null,
+            quietMillis = options.quietMillis || 100,
+            ajaxUrl = options.url,
+            self = this;
+
+        return function (query) {
+            window.clearTimeout(timeout);
+            timeout = window.setTimeout(function () {
+                var data = options.data, // ajax data function
+                    url = ajaxUrl, // ajax url string or function
+                    transport = options.transport || $.fn.select2.ajaxDefaults.transport,
+                    // deprecated - to be removed in 4.0  - use params instead
+                    deprecated = {
+                        type: options.type || 'GET', // set type of request (GET or POST)
+                        cache: options.cache || false,
+                        jsonpCallback: options.jsonpCallback||undefined,
+                        dataType: options.dataType||"json"
+                    },
+                    params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
+
+                data = data ? data.call(self, query.term, query.page, query.context) : null;
+                url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
+
+                if (handler && typeof handler.abort === "function") { handler.abort(); }
+
+                if (options.params) {
+                    if ($.isFunction(options.params)) {
+                        $.extend(params, options.params.call(self));
+                    } else {
+                        $.extend(params, options.params);
+                    }
+                }
+
+                $.extend(params, {
+                    url: url,
+                    dataType: options.dataType,
+                    data: data,
+                    success: function (data) {
+                        // TODO - replace query.page with query so users have access to term, page, etc.
+                        // added query as third paramter to keep backwards compatibility
+                        var results = options.results(data, query.page, query);
+                        query.callback(results);
+                    },
+                    error: function(jqXHR, textStatus, errorThrown){
+                        var results = {
+                            hasError: true,
+                            jqXHR: jqXHR,
+                            textStatus: textStatus,
+                            errorThrown: errorThrown
+                        };
+
+                        query.callback(results);
+                    }
+                });
+                handler = transport.call(self, params);
+            }, quietMillis);
+        };
+    }
+
+    /**
+     * Produces a query function that works with a local array
+     *
+     * @param options object containing configuration parameters. The options parameter can either be an array or an
+     * object.
+     *
+     * If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
+     *
+     * If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
+     * an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
+     * key can either be a String in which case it is expected that each element in the 'data' array has a key with the
+     * value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
+     * the text.
+     */
+    function local(options) {
+        var data = options, // data elements
+            dataText,
+            tmp,
+            text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
+
+         if ($.isArray(data)) {
+            tmp = data;
+            data = { results: tmp };
+        }
+
+         if ($.isFunction(data) === false) {
+            tmp = data;
+            data = function() { return tmp; };
+        }
+
+        var dataItem = data();
+        if (dataItem.text) {
+            text = dataItem.text;
+            // if text is not a function we assume it to be a key name
+            if (!$.isFunction(text)) {
+                dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
+                text = function (item) { return item[dataText]; };
+            }
+        }
+
+        return function (query) {
+            var t = query.term, filtered = { results: [] }, process;
+            if (t === "") {
+                query.callback(data());
+                return;
+            }
+
+            process = function(datum, collection) {
+                var group, attr;
+                datum = datum[0];
+                if (datum.children) {
+                    group = {};
+                    for (attr in datum) {
+                        if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
+                    }
+                    group.children=[];
+                    $(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
+                    if (group.children.length || query.matcher(t, text(group), datum)) {
+                        collection.push(group);
+                    }
+                } else {
+                    if (query.matcher(t, text(datum), datum)) {
+                        collection.push(datum);
+                    }
+                }
+            };
+
+            $(data().results).each2(function(i, datum) { process(datum, filtered.results); });
+            query.callback(filtered);
+        };
+    }
+
+    // TODO javadoc
+    function tags(data) {
+        var isFunc = $.isFunction(data);
+        return function (query) {
+            var t = query.term, filtered = {results: []};
+            var result = isFunc ? data(query) : data;
+            if ($.isArray(result)) {
+                $(result).each(function () {
+                    var isObject = this.text !== undefined,
+                        text = isObject ? this.text : this;
+                    if (t === "" || query.matcher(t, text)) {
+                        filtered.results.push(isObject ? this : {id: this, text: this});
+                    }
+                });
+                query.callback(filtered);
+            }
+        };
+    }
+
+    /**
+     * Checks if the formatter function should be used.
+     *
+     * Throws an error if it is not a function. Returns true if it should be used,
+     * false if no formatting should be performed.
+     *
+     * @param formatter
+     */
+    function checkFormatter(formatter, formatterName) {
+        if ($.isFunction(formatter)) return true;
+        if (!formatter) return false;
+        if (typeof(formatter) === 'string') return true;
+        throw new Error(formatterName +" must be a string, function, or falsy value");
+    }
+
+  /**
+   * Returns a given value
+   * If given a function, returns its output
+   *
+   * @param val string|function
+   * @param context value of "this" to be passed to function
+   * @returns {*}
+   */
+    function evaluate(val, context) {
+        if ($.isFunction(val)) {
+            var args = Array.prototype.slice.call(arguments, 2);
+            return val.apply(context, args);
+        }
+        return val;
+    }
+
+    function countResults(results) {
+        var count = 0;
+        $.each(results, function(i, item) {
+            if (item.children) {
+                count += countResults(item.children);
+            } else {
+                count++;
+            }
+        });
+        return count;
+    }
+
+    /**
+     * Default tokenizer. This function uses breaks the input on substring match of any string from the
+     * opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
+     * two options have to be defined in order for the tokenizer to work.
+     *
+     * @param input text user has typed so far or pasted into the search field
+     * @param selection currently selected choices
+     * @param selectCallback function(choice) callback tho add the choice to selection
+     * @param opts select2's opts
+     * @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
+     */
+    function defaultTokenizer(input, selection, selectCallback, opts) {
+        var original = input, // store the original so we can compare and know if we need to tell the search to update its text
+            dupe = false, // check for whether a token we extracted represents a duplicate selected choice
+            token, // token
+            index, // position at which the separator was found
+            i, l, // looping variables
+            separator; // the matched separator
+
+        if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
+
+        while (true) {
+            index = -1;
+
+            for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
+                separator = opts.tokenSeparators[i];
+                index = input.indexOf(separator);
+                if (index >= 0) break;
+            }
+
+            if (index < 0) break; // did not find any token separator in the input string, bail
+
+            token = input.substring(0, index);
+            input = input.substring(index + separator.length);
+
+            if (token.length > 0) {
+                token = opts.createSearchChoice.call(this, token, selection);
+                if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
+                    dupe = false;
+                    for (i = 0, l = selection.length; i < l; i++) {
+                        if (equal(opts.id(token), opts.id(selection[i]))) {
+                            dupe = true; break;
+                        }
+                    }
+
+                    if (!dupe) selectCallback(token);
+                }
+            }
+        }
+
+        if (original!==input) return input;
+    }
+
+    function cleanupJQueryElements() {
+        var self = this;
+
+        $.each(arguments, function (i, element) {
+            self[element].remove();
+            self[element] = null;
+        });
+    }
+
+    /**
+     * Creates a new class
+     *
+     * @param superClass
+     * @param methods
+     */
+    function clazz(SuperClass, methods) {
+        var constructor = function () {};
+        constructor.prototype = new SuperClass;
+        constructor.prototype.constructor = constructor;
+        constructor.prototype.parent = SuperClass.prototype;
+        constructor.prototype = $.extend(constructor.prototype, methods);
+        return constructor;
+    }
+
+    AbstractSelect2 = clazz(Object, {
+
+        // abstract
+        bind: function (func) {
+            var self = this;
+            return function () {
+                func.apply(self, arguments);
+            };
+        },
+
+        // abstract
+        init: function (opts) {
+            var results, search, resultsSelector = ".select2-results";
+
+            // prepare options
+            this.opts = opts = this.prepareOpts(opts);
+
+            this.id=opts.id;
+
+            // destroy if called on an existing component
+            if (opts.element.data("select2") !== undefined &&
+                opts.element.data("select2") !== null) {
+                opts.element.data("select2").destroy();
+            }
+
+            this.container = this.createContainer();
+
+            this.liveRegion = $('.select2-hidden-accessible');
+            if (this.liveRegion.length == 0) {
+                this.liveRegion = $("<span>", {
+                        role: "status",
+                        "aria-live": "polite"
+                    })
+                    .addClass("select2-hidden-accessible")
+                    .appendTo(document.body);
+            }
+
+            this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
+            this.containerEventName= this.containerId
+                .replace(/([.])/g, '_')
+                .replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
+            this.container.attr("id", this.containerId);
+
+            this.container.attr("title", opts.element.attr("title"));
+
+            this.body = $(document.body);
+
+            syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
+
+            this.container.attr("style", opts.element.attr("style"));
+            this.container.css(evaluate(opts.containerCss, this.opts.element));
+            this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
+
+            this.elementTabIndex = this.opts.element.attr("tabindex");
+
+            // swap container for the element
+            this.opts.element
+                .data("select2", this)
+                .attr("tabindex", "-1")
+                .before(this.container)
+                .on("click.select2", killEvent); // do not leak click events
+
+            this.container.data("select2", this);
+
+            this.dropdown = this.container.find(".select2-drop");
+
+            syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
+
+            this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
+            this.dropdown.data("select2", this);
+            this.dropdown.on("click", killEvent);
+
+            this.results = results = this.container.find(resultsSelector);
+            this.search = search = this.container.find("input.select2-input");
+
+            this.queryCount = 0;
+            this.resultsPage = 0;
+            this.context = null;
+
+            // initialize the container
+            this.initContainer();
+
+            this.container.on("click", killEvent);
+
+            installFilteredMouseMove(this.results);
+
+            this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
+            this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
+                this._touchEvent = true;
+                this.highlightUnderEvent(event);
+            }));
+            this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
+            this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
+
+            // Waiting for a click event on touch devices to select option and hide dropdown
+            // otherwise click will be triggered on an underlying element
+            this.dropdown.on('click', this.bind(function (event) {
+                if (this._touchEvent) {
+                    this._touchEvent = false;
+                    this.selectHighlighted();
+                }
+            }));
+
+            installDebouncedScroll(80, this.results);
+            this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
+
+            // do not propagate change event from the search field out of the component
+            $(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
+            $(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
+
+            // if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
+            if ($.fn.mousewheel) {
+                results.mousewheel(function (e, delta, deltaX, deltaY) {
+                    var top = results.scrollTop();
+                    if (deltaY > 0 && top - deltaY <= 0) {
+                        results.scrollTop(0);
+                        killEvent(e);
+                    } else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
+                        results.scrollTop(results.get(0).scrollHeight - results.height());
+                        killEvent(e);
+                    }
+                });
+            }
+
+            installKeyUpChangeEvent(search);
+            search.on("keyup-change input paste", this.bind(this.updateResults));
+            search.on("focus", function () { search.addClass("select2-focused"); });
+            search.on("blur", function () { search.removeClass("select2-focused");});
+
+            this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
+                if ($(e.target).closest(".select2-result-selectable").length > 0) {
+                    this.highlightUnderEvent(e);
+                    this.selectHighlighted(e);
+                }
+            }));
+
+            // trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
+            // for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
+            // dom it will trigger the popup close, which is not what we want
+            // focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
+            this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
+
+            this.nextSearchTerm = undefined;
+
+            if ($.isFunction(this.opts.initSelection)) {
+                // initialize selection based on the current value of the source element
+                this.initSelection();
+
+                // if the user has provided a function that can set selection based on the value of the source element
+                // we monitor the change event on the element and trigger it, allowing for two way synchronization
+                this.monitorSource();
+            }
+
+            if (opts.maximumInputLength !== null) {
+                this.search.attr("maxlength", opts.maximumInputLength);
+            }
+
+            var disabled = opts.element.prop("disabled");
+            if (disabled === undefined) disabled = false;
+            this.enable(!disabled);
+
+            var readonly = opts.element.prop("readonly");
+            if (readonly === undefined) readonly = false;
+            this.readonly(readonly);
+
+            // Calculate size of scrollbar
+            scrollBarDimensions = scrollBarDimensions || measureScrollbar();
+
+            this.autofocus = opts.element.prop("autofocus");
+            opts.element.prop("autofocus", false);
+            if (this.autofocus) this.focus();
+
+            this.search.attr("placeholder", opts.searchInputPlaceholder);
+        },
+
+        // abstract
+        destroy: function () {
+            var element=this.opts.element, select2 = element.data("select2"), self = this;
+
+            this.close();
+
+            if (element.length && element[0].detachEvent && self._sync) {
+                element.each(function () {
+                    if (self._sync) {
+                        this.detachEvent("onpropertychange", self._sync);
+                    }
+                });
+            }
+            if (this.propertyObserver) {
+                this.propertyObserver.disconnect();
+                this.propertyObserver = null;
+            }
+            this._sync = null;
+
+            if (select2 !== undefined) {
+                select2.container.remove();
+                select2.liveRegion.remove();
+                select2.dropdown.remove();
+                element
+                    .show()
+                    .removeData("select2")
+                    .off(".select2")
+                    .prop("autofocus", this.autofocus || false);
+                if (this.elementTabIndex) {
+                    element.attr({tabindex: this.elementTabIndex});
+                } else {
+                    element.removeAttr("tabindex");
+                }
+                element.show();
+            }
+
+            cleanupJQueryElements.call(this,
+                "container",
+                "liveRegion",
+                "dropdown",
+                "results",
+                "search"
+            );
+        },
+
+        // abstract
+        optionToData: function(element) {
+            if (element.is("option")) {
+                return {
+                    id:element.prop("value"),
+                    text:element.text(),
+                    element: element.get(),
+                    css: element.attr("class"),
+                    disabled: element.prop("disabled"),
+                    locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
+                };
+            } else if (element.is("optgroup")) {
+                return {
+                    text:element.attr("label"),
+                    children:[],
+                    element: element.get(),
+                    css: element.attr("class")
+                };
+            }
+        },
+
+        // abstract
+        prepareOpts: function (opts) {
+            var element, select, idKey, ajaxUrl, self = this;
+
+            element = opts.element;
+
+            if (element.get(0).tagName.toLowerCase() === "select") {
+                this.select = select = opts.element;
+            }
+
+            if (select) {
+                // these options are not allowed when attached to a select because they are picked up off the element itself
+                $.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
+                    if (this in opts) {
+                        throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
+                    }
+                });
+            }
+
+            opts = $.extend({}, {
+                populateResults: function(container, results, query) {
+                    var populate, id=this.opts.id, liveRegion=this.liveRegion;
+
+                    populate=function(results, container, depth) {
+
+                        var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
+
+                        results = opts.sortResults(results, container, query);
+
+                        // collect the created nodes for bulk append
+                        var nodes = [];
+                        for (i = 0, l = results.length; i < l; i = i + 1) {
+
+                            result=results[i];
+
+                            disabled = (result.disabled === true);
+                            selectable = (!disabled) && (id(result) !== undefined);
+
+                            compound=result.children && result.children.length > 0;
+
+                            node=$("<li></li>");
+                            node.addClass("select2-results-dept-"+depth);
+                            node.addClass("select2-result");
+                            node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
+                            if (disabled) { node.addClass("select2-disabled"); }
+                            if (compound) { node.addClass("select2-result-with-children"); }
+                            node.addClass(self.opts.formatResultCssClass(result));
+                            node.attr("role", "presentation");
+
+                            label=$(document.createElement("div"));
+                            label.addClass("select2-result-label");
+                            label.attr("id", "select2-result-label-" + nextUid());
+                            label.attr("role", "option");
+
+                            formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
+                            if (formatted!==undefined) {
+                                label.html(formatted);
+                                node.append(label);
+                            }
+
+
+                            if (compound) {
+
+                                innerContainer=$("<ul></ul>");
+                                innerContainer.addClass("select2-result-sub");
+                                populate(result.children, innerContainer, depth+1);
+                                node.append(innerContainer);
+                            }
+
+                            node.data("select2-data", result);
+                            nodes.push(node[0]);
+                        }
+
+                        // bulk append the created nodes
+                        container.append(nodes);
+                        liveRegion.text(opts.formatMatches(results.length));
+                    };
+
+                    populate(results, container, 0);
+                }
+            }, $.fn.select2.defaults, opts);
+
+            if (typeof(opts.id) !== "function") {
+                idKey = opts.id;
+                opts.id = function (e) { return e[idKey]; };
+            }
+
+            if ($.isArray(opts.element.data("select2Tags"))) {
+                if ("tags" in opts) {
+                    throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
+                }
+                opts.tags=opts.element.data("select2Tags");
+            }
+
+            if (select) {
+                opts.query = this.bind(function (query) {
+                    var data = { results: [], more: false },
+                        term = query.term,
+                        children, placeholderOption, process;
+
+                    process=function(element, collection) {
+                        var group;
+                        if (element.is("option")) {
+                            if (query.matcher(term, element.text(), element)) {
+                                collection.push(self.optionToData(element));
+                            }
+                        } else if (element.is("optgroup")) {
+                            group=self.optionToData(element);
+                            element.children().each2(function(i, elm) { process(elm, group.children); });
+                            if (group.children.length>0) {
+                                collection.push(group);
+                            }
+                        }
+                    };
+
+                    children=element.children();
+
+                    // ignore the placeholder option if there is one
+                    if (this.getPlaceholder() !== undefined && children.length > 0) {
+                        placeholderOption = this.getPlaceholderOption();
+                        if (placeholderOption) {
+                            children=children.not(placeholderOption);
+                        }
+                    }
+
+                    children.each2(function(i, elm) { process(elm, data.results); });
+
+                    query.callback(data);
+                });
+                // this is needed because inside val() we construct choices from options and their id is hardcoded
+                opts.id=function(e) { return e.id; };
+            } else {
+                if (!("query" in opts)) {
+
+                    if ("ajax" in opts) {
+                        ajaxUrl = opts.element.data("ajax-url");
+                        if (ajaxUrl && ajaxUrl.length > 0) {
+                            opts.ajax.url = ajaxUrl;
+                        }
+                        opts.query = ajax.call(opts.element, opts.ajax);
+                    } else if ("data" in opts) {
+                        opts.query = local(opts.data);
+                    } else if ("tags" in opts) {
+                        opts.query = tags(opts.tags);
+                        if (opts.createSearchChoice === undefined) {
+                            opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
+                        }
+                        if (opts.initSelection === undefined) {
+                            opts.initSelection = function (element, callback) {
+                                var data = [];
+                                $(splitVal(element.val(), opts.separator, opts.transformVal)).each(function () {
+                                    var obj = { id: this, text: this },
+                                        tags = opts.tags;
+                                    if ($.isFunction(tags)) tags=tags();
+                                    $(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
+                                    data.push(obj);
+                                });
+
+                                callback(data);
+                            };
+                        }
+                    }
+                }
+            }
+            if (typeof(opts.query) !== "function") {
+                throw "query function not defined for Select2 " + opts.element.attr("id");
+            }
+
+            if (opts.createSearchChoicePosition === 'top') {
+                opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
+            }
+            else if (opts.createSearchChoicePosition === 'bottom') {
+                opts.createSearchChoicePosition = function(list, item) { list.push(item); };
+            }
+            else if (typeof(opts.createSearchChoicePosition) !== "function")  {
+                throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
+            }
+
+            return opts;
+        },
+
+        /**
+         * Monitor the original element for changes and update select2 accordingly
+         */
+        // abstract
+        monitorSource: function () {
+            var el = this.opts.element, observer, self = this;
+
+            el.on("change.select2", this.bind(function (e) {
+                if (this.opts.element.data("select2-change-triggered") !== true) {
+                    this.initSelection();
+                }
+            }));
+
+            this._sync = this.bind(function () {
+
+                // sync enabled state
+                var disabled = el.prop("disabled");
+                if (disabled === undefined) disabled = false;
+                this.enable(!disabled);
+
+                var readonly = el.prop("readonly");
+                if (readonly === undefined) readonly = false;
+                this.readonly(readonly);
+
+                if (this.container) {
+                    syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
+                    this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
+                }
+
+                if (this.dropdown) {
+                    syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
+                    this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
+                }
+
+            });
+
+            // IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
+            if (el.length && el[0].attachEvent) {
+                el.each(function() {
+                    this.attachEvent("onpropertychange", self._sync);
+                });
+            }
+
+            // safari, chrome, firefox, IE11
+            observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver;
+            if (observer !== undefined) {
+                if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
+                this.propertyObserver = new observer(function (mutations) {
+                    $.each(mutations, self._sync);
+                });
+                this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
+            }
+        },
+
+        // abstract
+        triggerSelect: function(data) {
+            var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
+            this.opts.element.trigger(evt);
+            return !evt.isDefaultPrevented();
+        },
+
+        /**
+         * Triggers the change event on the source element
+         */
+        // abstract
+        triggerChange: function (details) {
+
+            details = details || {};
+            details= $.extend({}, details, { type: "change", val: this.val() });
+            // prevents recursive triggering
+            this.opts.element.data("select2-change-triggered", true);
+            this.opts.element.trigger(details);
+            this.opts.element.data("select2-change-triggered", false);
+
+            // some validation frameworks ignore the change event and listen instead to keyup, click for selects
+            // so here we trigger the click event manually
+            this.opts.element.click();
+
+            // ValidationEngine ignores the change event and listens instead to blur
+            // so here we trigger the blur event manually if so desired
+            if (this.opts.blurOnChange)
+                this.opts.element.blur();
+        },
+
+        //abstract
+        isInterfaceEnabled: function()
+        {
+            return this.enabledInterface === true;
+        },
+
+        // abstract
+        enableInterface: function() {
+            var enabled = this._enabled && !this._readonly,
+                disabled = !enabled;
+
+            if (enabled === this.enabledInterface) return false;
+
+            this.container.toggleClass("select2-container-disabled", disabled);
+            this.close();
+            this.enabledInterface = enabled;
+
+            return true;
+        },
+
+        // abstract
+        enable: function(enabled) {
+            if (enabled === undefined) enabled = true;
+            if (this._enabled === enabled) return;
+            this._enabled = enabled;
+
+            this.opts.element.prop("disabled", !enabled);
+            this.enableInterface();
+        },
+
+        // abstract
+        disable: function() {
+            this.enable(false);
+        },
+
+        // abstract
+        readonly: function(enabled) {
+            if (enabled === undefined) enabled = false;
+            if (this._readonly === enabled) return;
+            this._readonly = enabled;
+
+            this.opts.element.prop("readonly", enabled);
+            this.enableInterface();
+        },
+
+        // abstract
+        opened: function () {
+            return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
+        },
+
+        // abstract
+        positionDropdown: function() {
+            var $dropdown = this.dropdown,
+                container = this.container,
+                offset = container.offset(),
+                height = container.outerHeight(false),
+                width = container.outerWidth(false),
+                dropHeight = $dropdown.outerHeight(false),
+                $window = $(window),
+                windowWidth = $window.width(),
+                windowHeight = $window.height(),
+                viewPortRight = $window.scrollLeft() + windowWidth,
+                viewportBottom = $window.scrollTop() + windowHeight,
+                dropTop = offset.top + height,
+                dropLeft = offset.left,
+                enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
+                enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
+                dropWidth = $dropdown.outerWidth(false),
+                enoughRoomOnRight = function() {
+                    return dropLeft + dropWidth <= viewPortRight;
+                },
+                enoughRoomOnLeft = function() {
+                    return offset.left + viewPortRight + container.outerWidth(false)  > dropWidth;
+                },
+                aboveNow = $dropdown.hasClass("select2-drop-above"),
+                bodyOffset,
+                above,
+                changeDirection,
+                css,
+                resultsListNode;
+
+            // always prefer the current above/below alignment, unless there is not enough room
+            if (aboveNow) {
+                above = true;
+                if (!enoughRoomAbove && enoughRoomBelow) {
+                    changeDirection = true;
+                    above = false;
+                }
+            } else {
+                above = false;
+                if (!enoughRoomBelow && enoughRoomAbove) {
+                    changeDirection = true;
+                    above = true;
+                }
+            }
+
+            //if we are changing direction we need to get positions when dropdown is hidden;
+            if (changeDirection) {
+                $dropdown.hide();
+                offset = this.container.offset();
+                height = this.container.outerHeight(false);
+                width = this.container.outerWidth(false);
+                dropHeight = $dropdown.outerHeight(false);
+                viewPortRight = $window.scrollLeft() + windowWidth;
+                viewportBottom = $window.scrollTop() + windowHeight;
+                dropTop = offset.top + height;
+                dropLeft = offset.left;
+                dropWidth = $dropdown.outerWidth(false);
+                $dropdown.show();
+
+                // fix so the cursor does not move to the left within the search-textbox in IE
+                this.focusSearch();
+            }
+
+            if (this.opts.dropdownAutoWidth) {
+                resultsListNode = $('.select2-results', $dropdown)[0];
+                $dropdown.addClass('select2-drop-auto-width');
+                $dropdown.css('width', '');
+                // Add scrollbar width to dropdown if vertical scrollbar is present
+                dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
+                dropWidth > width ? width = dropWidth : dropWidth = width;
+                dropHeight = $dropdown.outerHeight(false);
+            }
+            else {
+                this.container.removeClass('select2-drop-auto-width');
+            }
+
+            //console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
+            //console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
+
+            // fix positioning when body has an offset and is not position: static
+            if (this.body.css('position') !== 'static') {
+                bodyOffset = this.body.offset();
+                dropTop -= bodyOffset.top;
+                dropLeft -= bodyOffset.left;
+            }
+
+            if (!enoughRoomOnRight() && enoughRoomOnLeft()) {
+                dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
+            }
+
+            css =  {
+                left: dropLeft,
+                width: width
+            };
+
+            if (above) {
+                css.top = offset.top - dropHeight;
+                css.bottom = 'auto';
+                this.container.addClass("select2-drop-above");
+                $dropdown.addClass("select2-drop-above");
+            }
+            else {
+                css.top = dropTop;
+                css.bottom = 'auto';
+                this.container.removeClass("select2-drop-above");
+                $dropdown.removeClass("select2-drop-above");
+            }
+            css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
+
+            $dropdown.css(css);
+        },
+
+        // abstract
+        shouldOpen: function() {
+            var event;
+
+            if (this.opened()) return false;
+
+            if (this._enabled === false || this._readonly === true) return false;
+
+            event = $.Event("select2-opening");
+            this.opts.element.trigger(event);
+            return !event.isDefaultPrevented();
+        },
+
+        // abstract
+        clearDropdownAlignmentPreference: function() {
+            // clear the classes used to figure out the preference of where the dropdown should be opened
+            this.container.removeClass("select2-drop-above");
+            this.dropdown.removeClass("select2-drop-above");
+        },
+
+        /**
+         * Opens the dropdown
+         *
+         * @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
+         * the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
+         */
+        // abstract
+        open: function () {
+
+            if (!this.shouldOpen()) return false;
+
+            this.opening();
+
+            // Only bind the document mousemove when the dropdown is visible
+            $document.on("mousemove.select2Event", function (e) {
+                lastMousePosition.x = e.pageX;
+                lastMousePosition.y = e.pageY;
+            });
+
+            return true;
+        },
+
+        /**
+         * Performs the opening of the dropdown
+         */
+        // abstract
+        opening: function() {
+            var cid = this.containerEventName,
+                scroll = "scroll." + cid,
+                resize = "resize."+cid,
+                orient = "orientationchange."+cid,
+                mask;
+
+            this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
+
+            this.clearDropdownAlignmentPreference();
+
+            if(this.dropdown[0] !== this.body.children().last()[0]) {
+                this.dropdown.detach().appendTo(this.body);
+            }
+
+            // create the dropdown mask if doesn't already exist
+            mask = $("#select2-drop-mask");
+            if (mask.length === 0) {
+                mask = $(document.createElement("div"));
+                mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
+                mask.hide();
+                mask.appendTo(this.body);
+                mask.on("mousedown touchstart click", function (e) {
+                    // Prevent IE from generating a click event on the body
+                    reinsertElement(mask);
+
+                    var dropdown = $("#select2-drop"), self;
+                    if (dropdown.length > 0) {
+                        self=dropdown.data("select2");
+                        if (self.opts.selectOnBlur) {
+                            self.selectHighlighted({noFocus: true});
+                        }
+                        self.close();
+                        e.preventDefault();
+                        e.stopPropagation();
+                    }
+                });
+            }
+
+            // ensure the mask is always right before the dropdown
+            if (this.dropdown.prev()[0] !== mask[0]) {
+                this.dropdown.before(mask);
+            }
+
+            // move the global id to the correct dropdown
+            $("#select2-drop").removeAttr("id");
+            this.dropdown.attr("id", "select2-drop");
+
+            // show the elements
+            mask.show();
+
+            this.positionDropdown();
+            this.dropdown.show();
+            this.positionDropdown();
+
+            this.dropdown.addClass("select2-drop-active");
+
+            // attach listeners to events that can change the position of the container and thus require
+            // the position of the dropdown to be updated as well so it does not come unglued from the container
+            var that = this;
+            this.container.parents().add(window).each(function () {
+                $(this).on(resize+" "+scroll+" "+orient, function (e) {
+                    if (that.opened()) that.positionDropdown();
+                });
+            });
+
+
+        },
+
+        // abstract
+        close: function () {
+            if (!this.opened()) return;
+
+            var cid = this.containerEventName,
+                scroll = "scroll." + cid,
+                resize = "resize."+cid,
+                orient = "orientationchange."+cid;
+
+            // unbind event listeners
+            this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
+
+            this.clearDropdownAlignmentPreference();
+
+            $("#select2-drop-mask").hide();
+            this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
+            this.dropdown.hide();
+            this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
+            this.results.empty();
+
+            // Now that the dropdown is closed, unbind the global document mousemove event
+            $document.off("mousemove.select2Event");
+
+            this.clearSearch();
+            this.search.removeClass("select2-active");
+            this.opts.element.trigger($.Event("select2-close"));
+        },
+
+        /**
+         * Opens control, sets input value, and updates results.
+         */
+        // abstract
+        externalSearch: function (term) {
+            this.open();
+            this.search.val(term);
+            this.updateResults(false);
+        },
+
+        // abstract
+        clearSearch: function () {
+
+        },
+
+        //abstract
+        getMaximumSelectionSize: function() {
+            return evaluate(this.opts.maximumSelectionSize, this.opts.element);
+        },
+
+        // abstract
+        ensureHighlightVisible: function () {
+            var results = this.results, children, index, child, hb, rb, y, more, topOffset;
+
+            index = this.highlight();
+
+            if (index < 0) return;
+
+            if (index == 0) {
+
+                // if the first element is highlighted scroll all the way to the top,
+                // that way any unselectable headers above it will also be scrolled
+                // into view
+
+                results.scrollTop(0);
+                return;
+            }
+
+            children = this.findHighlightableChoices().find('.select2-result-label');
+
+            child = $(children[index]);
+
+            topOffset = (child.offset() || {}).top || 0;
+
+            hb = topOffset + child.outerHeight(true);
+
+            // if this is the last child lets also make sure select2-more-results is visible
+            if (index === children.length - 1) {
+                more = results.find("li.select2-more-results");
+                if (more.length > 0) {
+                    hb = more.offset().top + more.outerHeight(true);
+                }
+            }
+
+            rb = results.offset().top + results.outerHeight(false);
+            if (hb > rb) {
+                results.scrollTop(results.scrollTop() + (hb - rb));
+            }
+            y = topOffset - results.offset().top;
+
+            // make sure the top of the element is visible
+            if (y < 0 && child.css('display') != 'none' ) {
+                results.scrollTop(results.scrollTop() + y); // y is negative
+            }
+        },
+
+        // abstract
+        findHighlightableChoices: function() {
+            return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
+        },
+
+        // abstract
+        moveHighlight: function (delta) {
+            var choices = this.findHighlightableChoices(),
+                index = this.highlight();
+
+            while (index > -1 && index < choices.length) {
+                index += delta;
+                var choice = $(choices[index]);
+                if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
+                    this.highlight(index);
+                    break;
+                }
+            }
+        },
+
+        // abstract
+        highlight: function (index) {
+            var choices = this.findHighlightableChoices(),
+                choice,
+                data;
+
+            if (arguments.length === 0) {
+                return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
+            }
+
+            if (index >= choices.length) index = choices.length - 1;
+            if (index < 0) index = 0;
+
+            this.removeHighlight();
+
+            choice = $(choices[index]);
+            choice.addClass("select2-highlighted");
+
+            // ensure assistive technology can determine the active choice
+            this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
+
+            this.ensureHighlightVisible();
+
+            this.liveRegion.text(choice.text());
+
+            data = choice.data("select2-data");
+            if (data) {
+                this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
+            }
+        },
+
+        removeHighlight: function() {
+            this.results.find(".select2-highlighted").removeClass("select2-highlighted");
+        },
+
+        touchMoved: function() {
+            this._touchMoved = true;
+        },
+
+        clearTouchMoved: function() {
+          this._touchMoved = false;
+        },
+
+        // abstract
+        countSelectableResults: function() {
+            return this.findHighlightableChoices().length;
+        },
+
+        // abstract
+        highlightUnderEvent: function (event) {
+            var el = $(event.target).closest(".select2-result-selectable");
+            if (el.length > 0 && !el.is(".select2-highlighted")) {
+                var choices = this.findHighlightableChoices();
+                this.highlight(choices.index(el));
+            } else if (el.length == 0) {
+                // if we are over an unselectable item remove all highlights
+                this.removeHighlight();
+            }
+        },
+
+        // abstract
+        loadMoreIfNeeded: function () {
+            var results = this.results,
+                more = results.find("li.select2-more-results"),
+                below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
+                page = this.resultsPage + 1,
+                self=this,
+                term=this.search.val(),
+                context=this.context;
+
+            if (more.length === 0) return;
+            below = more.offset().top - results.offset().top - results.height();
+
+            if (below <= this.opts.loadMorePadding) {
+                more.addClass("select2-active");
+                this.opts.query({
+                        element: this.opts.element,
+                        term: term,
+                        page: page,
+                        context: context,
+                        matcher: this.opts.matcher,
+                        callback: this.bind(function (data) {
+
+                    // ignore a response if the select2 has been closed before it was received
+                    if (!self.opened()) return;
+
+
+                    self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
+                    self.postprocessResults(data, false, false);
+
+                    if (data.more===true) {
+                        more.detach().appendTo(results).html(self.opts.escapeMarkup(evaluate(self.opts.formatLoadMore, self.opts.element, page+1)));
+                        window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
+                    } else {
+                        more.remove();
+                    }
+                    self.positionDropdown();
+                    self.resultsPage = page;
+                    self.context = data.context;
+                    this.opts.element.trigger({ type: "select2-loaded", items: data });
+                })});
+            }
+        },
+
+        /**
+         * Default tokenizer function which does nothing
+         */
+        tokenize: function() {
+
+        },
+
+        /**
+         * @param initial whether or not this is the call to this method right after the dropdown has been opened
+         */
+        // abstract
+        updateResults: function (initial) {
+            var search = this.search,
+                results = this.results,
+                opts = this.opts,
+                data,
+                self = this,
+                input,
+                term = search.val(),
+                lastTerm = $.data(this.container, "select2-last-term"),
+                // sequence number used to drop out-of-order responses
+                queryNumber;
+
+            // prevent duplicate queries against the same term
+            if (initial !== true && lastTerm && equal(term, lastTerm)) return;
+
+            $.data(this.container, "select2-last-term", term);
+
+            // if the search is currently hidden we do not alter the results
+            if (initial !== true && (this.showSearchInput === false || !this.opened())) {
+                return;
+            }
+
+            function postRender() {
+                search.removeClass("select2-active");
+                self.positionDropdown();
+                if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
+                    self.liveRegion.text(results.text());
+                }
+                else {
+                    self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable:not(".select2-selected")').length));
+                }
+            }
+
+            function render(html) {
+                results.html(html);
+                postRender();
+            }
+
+            queryNumber = ++this.queryCount;
+
+            var maxSelSize = this.getMaximumSelectionSize();
+            if (maxSelSize >=1) {
+                data = this.data();
+                if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
+                    render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + "</li>");
+                    return;
+                }
+            }
+
+            if (search.val().length < opts.minimumInputLength) {
+                if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
+                    render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + "</li>");
+                } else {
+                    render("");
+                }
+                if (initial && this.showSearch) this.showSearch(true);
+                return;
+            }
+
+            if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
+                if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
+                    render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + "</li>");
+                } else {
+                    render("");
+                }
+                return;
+            }
+
+            if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
+                render("<li class='select2-searching'>" + evaluate(opts.formatSearching, opts.element) + "</li>");
+            }
+
+            search.addClass("select2-active");
+
+            this.removeHighlight();
+
+            // give the tokenizer a chance to pre-process the input
+            input = this.tokenize();
+            if (input != undefined && input != null) {
+                search.val(input);
+            }
+
+            this.resultsPage = 1;
+
+            opts.query({
+                element: opts.element,
+                    term: search.val(),
+                    page: this.resultsPage,
+                    context: null,
+                    matcher: opts.matcher,
+                    callback: this.bind(function (data) {
+                var def; // default choice
+
+                // ignore old responses
+                if (queryNumber != this.queryCount) {
+                  return;
+                }
+
+                // ignore a response if the select2 has been closed before it was received
+                if (!this.opened()) {
+                    this.search.removeClass("select2-active");
+                    return;
+                }
+
+                // handle ajax error
+                if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
+                    render("<li class='select2-ajax-error'>" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + "</li>");
+                    return;
+                }
+
+                // save context, if any
+                this.context = (data.context===undefined) ? null : data.context;
+                // create a default choice and prepend it to the list
+                if (this.opts.createSearchChoice && search.val() !== "") {
+                    def = this.opts.createSearchChoice.call(self, search.val(), data.results);
+                    if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
+                        if ($(data.results).filter(
+                            function () {
+                                return equal(self.id(this), self.id(def));
+                            }).length === 0) {
+                            this.opts.createSearchChoicePosition(data.results, def);
+                        }
+                    }
+                }
+
+                if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
+                    render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, opts.element, search.val()) + "</li>");
+                    return;
+                }
+
+                results.empty();
+                self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
+
+                if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
+                    results.append("<li class='select2-more-results'>" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + "</li>");
+                    window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
+                }
+
+                this.postprocessResults(data, initial);
+
+                postRender();
+
+                this.opts.element.trigger({ type: "select2-loaded", items: data });
+            })});
+        },
+
+        // abstract
+        cancel: function () {
+            this.close();
+        },
+
+        // abstract
+        blur: function () {
+            // if selectOnBlur == true, select the currently highlighted option
+            if (this.opts.selectOnBlur)
+                this.selectHighlighted({noFocus: true});
+
+            this.close();
+            this.container.removeClass("select2-container-active");
+            // synonymous to .is(':focus'), which is available in jquery >= 1.6
+            if (this.search[0] === document.activeElement) { this.search.blur(); }
+            this.clearSearch();
+            this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
+        },
+
+        // abstract
+        focusSearch: function () {
+            focus(this.search);
+        },
+
+        // abstract
+        selectHighlighted: function (options) {
+            if (this._touchMoved) {
+              this.clearTouchMoved();
+              return;
+            }
+            var index=this.highlight(),
+                highlighted=this.results.find(".select2-highlighted"),
+                data = highlighted.closest('.select2-result').data("select2-data");
+
+            if (data) {
+                this.highlight(index);
+                this.onSelect(data, options);
+            } else if (options && options.noFocus) {
+                this.close();
+            }
+        },
+
+        // abstract
+        getPlaceholder: function () {
+            var placeholderOption;
+            return this.opts.element.attr("placeholder") ||
+                this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
+                this.opts.element.data("placeholder") ||
+                this.opts.placeholder ||
+                ((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
+        },
+
+        // abstract
+        getPlaceholderOption: function() {
+            if (this.select) {
+                var firstOption = this.select.children('option').first();
+                if (this.opts.placeholderOption !== undefined ) {
+                    //Determine the placeholder option based on the specified placeholderOption setting
+                    return (this.opts.placeholderOption === "first" && firstOption) ||
+                           (typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
+                } else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
+                    //No explicit placeholder option specified, use the first if it's blank
+                    return firstOption;
+                }
+            }
+        },
+
+        /**
+         * Get the desired width for the container element.  This is
+         * derived first from option `width` passed to select2, then
+         * the inline 'style' on the original element, and finally
+         * falls back to the jQuery calculated element width.
+         */
+        // abstract
+        initContainerWidth: function () {
+            function resolveContainerWidth() {
+                var style, attrs, matches, i, l, attr;
+
+                if (this.opts.width === "off") {
+                    return null;
+                } else if (this.opts.width === "element"){
+                    return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
+                } else if (this.opts.width === "copy" || this.opts.width === "resolve") {
+                    // check if there is inline style on the element that contains width
+                    style = this.opts.element.attr('style');
+                    if (style !== undefined) {
+                        attrs = style.split(';');
+                        for (i = 0, l = attrs.length; i < l; i = i + 1) {
+                            attr = attrs[i].replace(/\s/g, '');
+                            matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
+                            if (matches !== null && matches.length >= 1)
+                                return matches[1];
+                        }
+                    }
+
+                    if (this.opts.width === "resolve") {
+                        // next check if css('width') can resolve a width that is percent based, this is sometimes possible
+                        // when attached to input type=hidden or elements hidden via css
+                        style = this.opts.element.css('width');
+                        if (style.indexOf("%") > 0) return style;
+
+                        // finally, fallback on the calculated width of the element
+                        return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
+                    }
+
+                    return null;
+                } else if ($.isFunction(this.opts.width)) {
+                    return this.opts.width();
+                } else {
+                    return this.opts.width;
+               }
+            };
+
+            var width = resolveContainerWidth.call(this);
+            if (width !== null) {
+                this.container.css("width", width);
+            }
+        }
+    });
+
+    SingleSelect2 = clazz(AbstractSelect2, {
+
+        // single
+
+        createContainer: function () {
+            var container = $(document.createElement("div")).attr({
+                "class": "select2-container"
+            }).html([
+                "<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>",
+                "   <span class='select2-chosen'>&#160;</span><abbr class='select2-search-choice-close'></abbr>",
+                "   <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>",
+                "</a>",
+                "<label for='' class='select2-offscreen'></label>",
+                "<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />",
+                "<div class='select2-drop select2-display-none'>",
+                "   <div class='select2-search'>",
+                "       <label for='' class='select2-offscreen'></label>",
+                "       <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'",
+                "       aria-autocomplete='list' />",
+                "   </div>",
+                "   <ul class='select2-results' role='listbox'>",
+                "   </ul>",
+                "</div>"].join(""));
+            return container;
+        },
+
+        // single
+        enableInterface: function() {
+            if (this.parent.enableInterface.apply(this, arguments)) {
+                this.focusser.prop("disabled", !this.isInterfaceEnabled());
+            }
+        },
+
+        // single
+        opening: function () {
+            var el, range, len;
+
+            if (this.opts.minimumResultsForSearch >= 0) {
+                this.showSearch(true);
+            }
+
+            this.parent.opening.apply(this, arguments);
+
+            if (this.showSearchInput !== false) {
+                // IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
+                // all other browsers handle this just fine
+
+                this.search.val(this.focusser.val());
+            }
+            if (this.opts.shouldFocusInput(this)) {
+                this.search.focus();
+                // move the cursor to the end after focussing, otherwise it will be at the beginning and
+                // new text will appear *before* focusser.val()
+                el = this.search.get(0);
+                if (el.createTextRange) {
+                    range = el.createTextRange();
+                    range.collapse(false);
+                    range.select();
+                } else if (el.setSelectionRange) {
+                    len = this.search.val().length;
+                    el.setSelectionRange(len, len);
+                }
+            }
+
+            // initializes search's value with nextSearchTerm (if defined by user)
+            // ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
+            if(this.search.val() === "") {
+                if(this.nextSearchTerm != undefined){
+                    this.search.val(this.nextSearchTerm);
+                    this.search.select();
+                }
+            }
+
+            this.focusser.prop("disabled", true).val("");
+            this.updateResults(true);
+            this.opts.element.trigger($.Event("select2-open"));
+        },
+
+        // single
+        close: function () {
+            if (!this.opened()) return;
+            this.parent.close.apply(this, arguments);
+
+            this.focusser.prop("disabled", false);
+
+            if (this.opts.shouldFocusInput(this)) {
+                this.focusser.focus();
+            }
+        },
+
+        // single
+        focus: function () {
+            if (this.opened()) {
+                this.close();
+            } else {
+                this.focusser.prop("disabled", false);
+                if (this.opts.shouldFocusInput(this)) {
+                    this.focusser.focus();
+                }
+            }
+        },
+
+        // single
+        isFocused: function () {
+            return this.container.hasClass("select2-container-active");
+        },
+
+        // single
+        cancel: function () {
+            this.parent.cancel.apply(this, arguments);
+            this.focusser.prop("disabled", false);
+
+            if (this.opts.shouldFocusInput(this)) {
+                this.focusser.focus();
+            }
+        },
+
+        // single
+        destroy: function() {
+            $("label[for='" + this.focusser.attr('id') + "']")
+                .attr('for', this.opts.element.attr("id"));
+            this.parent.destroy.apply(this, arguments);
+
+            cleanupJQueryElements.call(this,
+                "selection",
+                "focusser"
+            );
+        },
+
+        // single
+        initContainer: function () {
+
+            var selection,
+                container = this.container,
+                dropdown = this.dropdown,
+                idSuffix = nextUid(),
+                elementLabel;
+
+            if (this.opts.minimumResultsForSearch < 0) {
+                this.showSearch(false);
+            } else {
+                this.showSearch(true);
+            }
+
+            this.selection = selection = container.find(".select2-choice");
+
+            this.focusser = container.find(".select2-focusser");
+
+            // add aria associations
+            selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
+            this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
+            this.results.attr("id", "select2-results-"+idSuffix);
+            this.search.attr("aria-owns", "select2-results-"+idSuffix);
+
+            // rewrite labels from original element to focusser
+            this.focusser.attr("id", "s2id_autogen"+idSuffix);
+
+            elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
+            this.opts.element.focus(this.bind(function () { this.focus(); }));
+
+            this.focusser.prev()
+                .text(elementLabel.text())
+                .attr('for', this.focusser.attr('id'));
+
+            // Ensure the original element retains an accessible name
+            var originalTitle = this.opts.element.attr("title");
+            this.opts.element.attr("title", (originalTitle || elementLabel.text()));
+
+            this.focusser.attr("tabindex", this.elementTabIndex);
+
+            // write label for search field using the label from the focusser element
+            this.search.attr("id", this.focusser.attr('id') + '_search');
+
+            this.search.prev()
+                .text($("label[for='" + this.focusser.attr('id') + "']").text())
+                .attr('for', this.search.attr('id'));
+
+            this.search.on("keydown", this.bind(function (e) {
+                if (!this.isInterfaceEnabled()) return;
+
+                // filter 229 keyCodes (input method editor is processing key input)
+                if (229 == e.keyCode) return;
+
+                if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
+                    // prevent the page from scrolling
+                    killEvent(e);
+                    return;
+                }
+
+                switch (e.which) {
+                    case KEY.UP:
+                    case KEY.DOWN:
+                        this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
+                        killEvent(e);
+                        return;
+                    case KEY.ENTER:
+                        this.selectHighlighted();
+                        killEvent(e);
+                        return;
+                    case KEY.TAB:
+                        this.selectHighlighted({noFocus: true});
+                        return;
+                    case KEY.ESC:
+                        this.cancel(e);
+                        killEvent(e);
+                        return;
+                }
+            }));
+
+            this.search.on("blur", this.bind(function(e) {
+                // a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
+                // without this the search field loses focus which is annoying
+                if (document.activeElement === this.body.get(0)) {
+                    window.setTimeout(this.bind(function() {
+                        if (this.opened()) {
+                            this.search.focus();
+                        }
+                    }), 0);
+                }
+            }));
+
+            this.focusser.on("keydown", this.bind(function (e) {
+                if (!this.isInterfaceEnabled()) return;
+
+                if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
+                    return;
+                }
+
+                if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
+                    killEvent(e);
+                    return;
+                }
+
+                if (e.which == KEY.DOWN || e.which == KEY.UP
+                    || (e.which == KEY.ENTER && this.opts.openOnEnter)) {
+
+                    if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
+
+                    this.open();
+                    killEvent(e);
+                    return;
+                }
+
+                if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
+                    if (this.opts.allowClear) {
+                        this.clear();
+                    }
+                    killEvent(e);
+                    return;
+                }
+            }));
+
+
+            installKeyUpChangeEvent(this.focusser);
+            this.focusser.on("keyup-change input", this.bind(function(e) {
+                if (this.opts.minimumResultsForSearch >= 0) {
+                    e.stopPropagation();
+                    if (this.opened()) return;
+                    this.open();
+                }
+            }));
+
+            selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
+                if (!this.isInterfaceEnabled()) {
+                    return;
+                }
+
+                this.clear();
+                killEventImmediately(e);
+                this.close();
+
+                if (this.selection) {
+                    this.selection.focus();
+                }
+            }));
+
+            selection.on("mousedown touchstart", this.bind(function (e) {
+                // Prevent IE from generating a click event on the body
+                reinsertElement(selection);
+
+                if (!this.container.hasClass("select2-container-active")) {
+                    this.opts.element.trigger($.Event("select2-focus"));
+                }
+
+                if (this.opened()) {
+                    this.close();
+                } else if (this.isInterfaceEnabled()) {
+                    this.open();
+                }
+
+                killEvent(e);
+            }));
+
+            dropdown.on("mousedown touchstart", this.bind(function() {
+                if (this.opts.shouldFocusInput(this)) {
+                    this.search.focus();
+                }
+            }));
+
+            selection.on("focus", this.bind(function(e) {
+                killEvent(e);
+            }));
+
+            this.focusser.on("focus", this.bind(function(){
+                if (!this.container.hasClass("select2-container-active")) {
+                    this.opts.element.trigger($.Event("select2-focus"));
+                }
+                this.container.addClass("select2-container-active");
+            })).on("blur", this.bind(function() {
+                if (!this.opened()) {
+                    this.container.removeClass("select2-container-active");
+                    this.opts.element.trigger($.Event("select2-blur"));
+                }
+            }));
+            this.search.on("focus", this.bind(function(){
+                if (!this.container.hasClass("select2-container-active")) {
+                    this.opts.element.trigger($.Event("select2-focus"));
+                }
+                this.container.addClass("select2-container-active");
+            }));
+
+            this.initContainerWidth();
+            this.opts.element.hide();
+            this.setPlaceholder();
+
+        },
+
+        // single
+        clear: function(triggerChange) {
+            var data=this.selection.data("select2-data");
+            if (data) { // guard against queued quick consecutive clicks
+                var evt = $.Event("select2-clearing");
+                this.opts.element.trigger(evt);
+                if (evt.isDefaultPrevented()) {
+                    return;
+                }
+                var placeholderOption = this.getPlaceholderOption();
+                this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
+                this.selection.find(".select2-chosen").empty();
+                this.selection.removeData("select2-data");
+                this.setPlaceholder();
+
+                if (triggerChange !== false){
+                    this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
+                    this.triggerChange({removed:data});
+                }
+            }
+        },
+
+        /**
+         * Sets selection based on source element's value
+         */
+        // single
+        initSelection: function () {
+            var selected;
+            if (this.isPlaceholderOptionSelected()) {
+                this.updateSelection(null);
+                this.close();
+                this.setPlaceholder();
+            } else {
+                var self = this;
+                this.opts.initSelection.call(null, this.opts.element, function(selected){
+                    if (selected !== undefined && selected !== null) {
+                        self.updateSelection(selected);
+                        self.close();
+                        self.setPlaceholder();
+                        self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val());
+                    }
+                });
+            }
+        },
+
+        isPlaceholderOptionSelected: function() {
+            var placeholderOption;
+            if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
+            return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
+                || (this.opts.element.val() === "")
+                || (this.opts.element.val() === undefined)
+                || (this.opts.element.val() === null);
+        },
+
+        // single
+        prepareOpts: function () {
+            var opts = this.parent.prepareOpts.apply(this, arguments),
+                self=this;
+
+            if (opts.element.get(0).tagName.toLowerCase() === "select") {
+                // install the selection initializer
+                opts.initSelection = function (element, callback) {
+                    var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
+                    // a single select box always has a value, no need to null check 'selected'
+                    callback(self.optionToData(selected));
+                };
+            } else if ("data" in opts) {
+                // install default initSelection when applied to hidden input and data is local
+                opts.initSelection = opts.initSelection || function (element, callback) {
+                    var id = element.val();
+                    //search in data by id, storing the actual matching item
+                    var match = null;
+                    opts.query({
+                        matcher: function(term, text, el){
+                            var is_match = equal(id, opts.id(el));
+                            if (is_match) {
+                                match = el;
+                            }
+                            return is_match;
+                        },
+                        callback: !$.isFunction(callback) ? $.noop : function() {
+                            callback(match);
+                        }
+                    });
+                };
+            }
+
+            return opts;
+        },
+
+        // single
+        getPlaceholder: function() {
+            // if a placeholder is specified on a single select without a valid placeholder option ignore it
+            if (this.select) {
+                if (this.getPlaceholderOption() === undefined) {
+                    return undefined;
+                }
+            }
+
+            return this.parent.getPlaceholder.apply(this, arguments);
+        },
+
+        // single
+        setPlaceholder: function () {
+            var placeholder = this.getPlaceholder();
+
+            if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
+
+                // check for a placeholder option if attached to a select
+                if (this.select && this.getPlaceholderOption() === undefined) return;
+
+                this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
+
+                this.selection.addClass("select2-default");
+
+                this.container.removeClass("select2-allowclear");
+            }
+        },
+
+        // single
+        postprocessResults: function (data, initial, noHighlightUpdate) {
+            var selected = 0, self = this, showSearchInput = true;
+
+            // find the selected element in the result list
+
+            this.findHighlightableChoices().each2(function (i, elm) {
+                if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
+                    selected = i;
+                    return false;
+                }
+            });
+
+            // and highlight it
+            if (noHighlightUpdate !== false) {
+                if (initial === true && selected >= 0) {
+                    this.highlight(selected);
+                } else {
+                    this.highlight(0);
+                }
+            }
+
+            // hide the search box if this is the first we got the results and there are enough of them for search
+
+            if (initial === true) {
+                var min = this.opts.minimumResultsForSearch;
+                if (min >= 0) {
+                    this.showSearch(countResults(data.results) >= min);
+                }
+            }
+        },
+
+        // single
+        showSearch: function(showSearchInput) {
+            if (this.showSearchInput === showSearchInput) return;
+
+            this.showSearchInput = showSearchInput;
+
+            this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
+            this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
+            //add "select2-with-searchbox" to the container if search box is shown
+            $(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
+        },
+
+        // single
+        onSelect: function (data, options) {
+
+            if (!this.triggerSelect(data)) { return; }
+
+            var old = this.opts.element.val(),
+                oldData = this.data();
+
+            this.opts.element.val(this.id(data));
+            this.updateSelection(data);
+
+            this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
+
+            this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
+            this.close();
+
+            if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) {
+                this.focusser.focus();
+            }
+
+            if (!equal(old, this.id(data))) {
+                this.triggerChange({ added: data, removed: oldData });
+            }
+        },
+
+        // single
+        updateSelection: function (data) {
+
+            var container=this.selection.find(".select2-chosen"), formatted, cssClass;
+
+            this.selection.data("select2-data", data);
+
+            container.empty();
+            if (data !== null) {
+                formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
+            }
+            if (formatted !== undefined) {
+                container.append(formatted);
+            }
+            cssClass=this.opts.formatSelectionCssClass(data, container);
+            if (cssClass !== undefined) {
+                container.addClass(cssClass);
+            }
+
+            this.selection.removeClass("select2-default");
+
+            if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
+                this.container.addClass("select2-allowclear");
+            }
+        },
+
+        // single
+        val: function () {
+            var val,
+                triggerChange = false,
+                data = null,
+                self = this,
+                oldData = this.data();
+
+            if (arguments.length === 0) {
+                return this.opts.element.val();
+            }
+
+            val = arguments[0];
+
+            if (arguments.length > 1) {
+                triggerChange = arguments[1];
+            }
+
+            if (this.select) {
+                this.select
+                    .val(val)
+                    .find("option").filter(function() { return this.selected }).each2(function (i, elm) {
+                        data = self.optionToData(elm);
+                        return false;
+                    });
+                this.updateSelection(data);
+                this.setPlaceholder();
+                if (triggerChange) {
+                    this.triggerChange({added: data, removed:oldData});
+                }
+            } else {
+                // val is an id. !val is true for [undefined,null,'',0] - 0 is legal
+                if (!val && val !== 0) {
+                    this.clear(triggerChange);
+                    return;
+                }
+                if (this.opts.initSelection === undefined) {
+                    throw new Error("cannot call val() if initSelection() is not defined");
+                }
+                this.opts.element.val(val);
+                this.opts.initSelection(this.opts.element, function(data){
+                    self.opts.element.val(!data ? "" : self.id(data));
+                    self.updateSelection(data);
+                    self.setPlaceholder();
+                    if (triggerChange) {
+                        self.triggerChange({added: data, removed:oldData});
+                    }
+                });
+            }
+        },
+
+        // single
+        clearSearch: function () {
+            this.search.val("");
+            this.focusser.val("");
+        },
+
+        // single
+        data: function(value) {
+            var data,
+                triggerChange = false;
+
+            if (arguments.length === 0) {
+                data = this.selection.data("select2-data");
+                if (data == undefined) data = null;
+                return data;
+            } else {
+                if (arguments.length > 1) {
+                    triggerChange = arguments[1];
+                }
+                if (!value) {
+                    this.clear(triggerChange);
+                } else {
+                    data = this.data();
+                    this.opts.element.val(!value ? "" : this.id(value));
+                    this.updateSelection(value);
+                    if (triggerChange) {
+                        this.triggerChange({added: value, removed:data});
+                    }
+                }
+            }
+        }
+    });
+
+    MultiSelect2 = clazz(AbstractSelect2, {
+
+        // multi
+        createContainer: function () {
+            var container = $(document.createElement("div")).attr({
+                "class": "select2-container select2-container-multi"
+            }).html([
+                "<ul class='select2-choices'>",
+                "  <li class='select2-search-field'>",
+                "    <label for='' class='select2-offscreen'></label>",
+                "    <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
+                "  </li>",
+                "</ul>",
+                "<div class='select2-drop select2-drop-multi select2-display-none'>",
+                "   <ul class='select2-results'>",
+                "   </ul>",
+                "</div>"].join(""));
+            return container;
+        },
+
+        // multi
+        prepareOpts: function () {
+            var opts = this.parent.prepareOpts.apply(this, arguments),
+                self=this;
+
+            // TODO validate placeholder is a string if specified
+            if (opts.element.get(0).tagName.toLowerCase() === "select") {
+                // install the selection initializer
+                opts.initSelection = function (element, callback) {
+
+                    var data = [];
+
+                    element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
+                        data.push(self.optionToData(elm));
+                    });
+                    callback(data);
+                };
+            } else if ("data" in opts) {
+                // install default initSelection when applied to hidden input and data is local
+                opts.initSelection = opts.initSelection || function (element, callback) {
+                    var ids = splitVal(element.val(), opts.separator, opts.transformVal);
+                    //search in data by array of ids, storing matching items in a list
+                    var matches = [];
+                    opts.query({
+                        matcher: function(term, text, el){
+                            var is_match = $.grep(ids, function(id) {
+                                return equal(id, opts.id(el));
+                            }).length;
+                            if (is_match) {
+                                matches.push(el);
+                            }
+                            return is_match;
+                        },
+                        callback: !$.isFunction(callback) ? $.noop : function() {
+                            // reorder matches based on the order they appear in the ids array because right now
+                            // they are in the order in which they appear in data array
+                            var ordered = [];
+                            for (var i = 0; i < ids.length; i++) {
+                                var id = ids[i];
+                                for (var j = 0; j < matches.length; j++) {
+                                    var match = matches[j];
+                                    if (equal(id, opts.id(match))) {
+                                        ordered.push(match);
+                                        matches.splice(j, 1);
+                                        break;
+                                    }
+                                }
+                            }
+                            callback(ordered);
+                        }
+                    });
+                };
+            }
+
+            return opts;
+        },
+
+        // multi
+        selectChoice: function (choice) {
+
+            var selected = this.container.find(".select2-search-choice-focus");
+            if (selected.length && choice && choice[0] == selected[0]) {
+
+            } else {
+                if (selected.length) {
+                    this.opts.element.trigger("choice-deselected", selected);
+                }
+                selected.removeClass("select2-search-choice-focus");
+                if (choice && choice.length) {
+                    this.close();
+                    choice.addClass("select2-search-choice-focus");
+                    this.opts.element.trigger("choice-selected", choice);
+                }
+            }
+        },
+
+        // multi
+        destroy: function() {
+            $("label[for='" + this.search.attr('id') + "']")
+                .attr('for', this.opts.element.attr("id"));
+            this.parent.destroy.apply(this, arguments);
+
+            cleanupJQueryElements.call(this,
+                "searchContainer",
+                "selection"
+            );
+        },
+
+        // multi
+        initContainer: function () {
+
+            var selector = ".select2-choices", selection;
+
+            this.searchContainer = this.container.find(".select2-search-field");
+            this.selection = selection = this.container.find(selector);
+
+            var _this = this;
+            this.selection.on("click", ".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)", function (e) {
+                _this.search[0].focus();
+                _this.selectChoice($(this));
+            });
+
+            // rewrite labels from original element to focusser
+            this.search.attr("id", "s2id_autogen"+nextUid());
+
+            this.search.prev()
+                .text($("label[for='" + this.opts.element.attr("id") + "']").text())
+                .attr('for', this.search.attr('id'));
+            this.opts.element.focus(this.bind(function () { this.focus(); }));
+
+            this.search.on("input paste", this.bind(function() {
+                if (this.search.attr('placeholder') && this.search.val().length == 0) return;
+                if (!this.isInterfaceEnabled()) return;
+                if (!this.opened()) {
+                    this.open();
+                }
+            }));
+
+            this.search.attr("tabindex", this.elementTabIndex);
+
+            this.keydowns = 0;
+            this.search.on("keydown", this.bind(function (e) {
+                if (!this.isInterfaceEnabled()) return;
+
+                ++this.keydowns;
+                var selected = selection.find(".select2-search-choice-focus");
+                var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
+                var next = selected.next(".select2-search-choice:not(.select2-locked)");
+                var pos = getCursorInfo(this.search);
+
+                if (selected.length &&
+                    (e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
+                    var selectedChoice = selected;
+                    if (e.which == KEY.LEFT && prev.length) {
+                        selectedChoice = prev;
+                    }
+                    else if (e.which == KEY.RIGHT) {
+                        selectedChoice = next.length ? next : null;
+                    }
+                    else if (e.which === KEY.BACKSPACE) {
+                        if (this.unselect(selected.first())) {
+                            this.search.width(10);
+                            selectedChoice = prev.length ? prev : next;
+                        }
+                    } else if (e.which == KEY.DELETE) {
+                        if (this.unselect(selected.first())) {
+                            this.search.width(10);
+                            selectedChoice = next.length ? next : null;
+                        }
+                    } else if (e.which == KEY.ENTER) {
+                        selectedChoice = null;
+                    }
+
+                    this.selectChoice(selectedChoice);
+                    killEvent(e);
+                    if (!selectedChoice || !selectedChoice.length) {
+                        this.open();
+                    }
+                    return;
+                } else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
+                    || e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
+
+                    this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
+                    killEvent(e);
+                    return;
+                } else {
+                    this.selectChoice(null);
+                }
+
+                if (this.opened()) {
+                    switch (e.which) {
+                    case KEY.UP:
+                    case KEY.DOWN:
+                        this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
+                        killEvent(e);
+                        return;
+                    case KEY.ENTER:
+                        this.selectHighlighted();
+                        killEvent(e);
+                        return;
+                    case KEY.TAB:
+                        this.selectHighlighted({noFocus:true});
+                        this.close();
+                        return;
+                    case KEY.ESC:
+                        this.cancel(e);
+                        killEvent(e);
+                        return;
+                    }
+                }
+
+                if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
+                 || e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
+                    return;
+                }
+
+                if (e.which === KEY.ENTER) {
+                    if (this.opts.openOnEnter === false) {
+                        return;
+                    } else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
+                        return;
+                    }
+                }
+
+                this.open();
+
+                if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
+                    // prevent the page from scrolling
+                    killEvent(e);
+                }
+
+                if (e.which === KEY.ENTER) {
+                    // prevent form from being submitted
+                    killEvent(e);
+                }
+
+            }));
+
+            this.search.on("keyup", this.bind(function (e) {
+                this.keydowns = 0;
+                this.resizeSearch();
+            })
+            );
+
+            this.search.on("blur", this.bind(function(e) {
+                this.container.removeClass("select2-container-active");
+                this.search.removeClass("select2-focused");
+                this.selectChoice(null);
+                if (!this.opened()) this.clearSearch();
+                e.stopImmediatePropagation();
+                this.opts.element.trigger($.Event("select2-blur"));
+            }));
+
+            this.container.on("click", selector, this.bind(function (e) {
+                if (!this.isInterfaceEnabled()) return;
+                if ($(e.target).closest(".select2-search-choice").length > 0) {
+                    // clicked inside a select2 search choice, do not open
+                    return;
+                }
+                this.selectChoice(null);
+                this.clearPlaceholder();
+                if (!this.container.hasClass("select2-container-active")) {
+                    this.opts.element.trigger($.Event("select2-focus"));
+                }
+                this.open();
+                this.focusSearch();
+                e.preventDefault();
+            }));
+
+            this.container.on("focus", selector, this.bind(function () {
+                if (!this.isInterfaceEnabled()) return;
+                if (!this.container.hasClass("select2-container-active")) {
+                    this.opts.element.trigger($.Event("select2-focus"));
+                }
+                this.container.addClass("select2-container-active");
+                this.dropdown.addClass("select2-drop-active");
+                this.clearPlaceholder();
+            }));
+
+            this.initContainerWidth();
+            this.opts.element.hide();
+
+            // set the placeholder if necessary
+            this.clearSearch();
+        },
+
+        // multi
+        enableInterface: function() {
+            if (this.parent.enableInterface.apply(this, arguments)) {
+                this.search.prop("disabled", !this.isInterfaceEnabled());
+            }
+        },
+
+        // multi
+        initSelection: function () {
+            var data;
+            if (this.opts.element.val() === "" && this.opts.element.text() === "") {
+                this.updateSelection([]);
+                this.close();
+                // set the placeholder if necessary
+                this.clearSearch();
+            }
+            if (this.select || this.opts.element.val() !== "") {
+                var self = this;
+                this.opts.initSelection.call(null, this.opts.element, function(data){
+                    if (data !== undefined && data !== null) {
+                        self.updateSelection(data);
+                        self.close();
+                        // set the placeholder if necessary
+                        self.clearSearch();
+                    }
+                });
+            }
+        },
+
+        // multi
+        clearSearch: function () {
+            var placeholder = this.getPlaceholder(),
+                maxWidth = this.getMaxSearchWidth();
+
+            if (placeholder !== undefined  && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
+                this.search.val(placeholder).addClass("select2-default");
+                // stretch the search box to full width of the container so as much of the placeholder is visible as possible
+                // we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
+                this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
+            } else {
+                this.search.val("").width(10);
+            }
+        },
+
+        // multi
+        clearPlaceholder: function () {
+            if (this.search.hasClass("select2-default")) {
+                this.search.val("").removeClass("select2-default");
+            }
+        },
+
+        // multi
+        opening: function () {
+            this.clearPlaceholder(); // should be done before super so placeholder is not used to search
+            this.resizeSearch();
+
+            this.parent.opening.apply(this, arguments);
+
+            this.focusSearch();
+
+            // initializes search's value with nextSearchTerm (if defined by user)
+            // ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
+            if(this.search.val() === "") {
+                if(this.nextSearchTerm != undefined){
+                    this.search.val(this.nextSearchTerm);
+                    this.search.select();
+                }
+            }
+
+            this.updateResults(true);
+            if (this.opts.shouldFocusInput(this)) {
+                this.search.focus();
+            }
+            this.opts.element.trigger($.Event("select2-open"));
+        },
+
+        // multi
+        close: function () {
+            if (!this.opened()) return;
+            this.parent.close.apply(this, arguments);
+        },
+
+        // multi
+        focus: function () {
+            this.close();
+            this.search.focus();
+        },
+
+        // multi
+        isFocused: function () {
+            return this.search.hasClass("select2-focused");
+        },
+
+        // multi
+        updateSelection: function (data) {
+            var ids = [], filtered = [], self = this;
+
+            // filter out duplicates
+            $(data).each(function () {
+                if (indexOf(self.id(this), ids) < 0) {
+                    ids.push(self.id(this));
+                    filtered.push(this);
+                }
+            });
+            data = filtered;
+
+            this.selection.find(".select2-search-choice").remove();
+            $(data).each(function () {
+                self.addSelectedChoice(this);
+            });
+            self.postprocessResults();
+        },
+
+        // multi
+        tokenize: function() {
+            var input = this.search.val();
+            input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
+            if (input != null && input != undefined) {
+                this.search.val(input);
+                if (input.length > 0) {
+                    this.open();
+                }
+            }
+
+        },
+
+        // multi
+        onSelect: function (data, options) {
+
+            if (!this.triggerSelect(data) || data.text === "") { return; }
+
+            this.addSelectedChoice(data);
+
+            this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
+
+            // keep track of the search's value before it gets cleared
+            this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
+
+            this.clearSearch();
+            this.updateResults();
+
+            if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
+
+            if (this.opts.closeOnSelect) {
+                this.close();
+                this.search.width(10);
+            } else {
+                if (this.countSelectableResults()>0) {
+                    this.search.width(10);
+                    this.resizeSearch();
+                    if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
+                        // if we reached max selection size repaint the results so choices
+                        // are replaced with the max selection reached message
+                        this.updateResults(true);
+                    } else {
+                        // initializes search's value with nextSearchTerm and update search result
+                        if(this.nextSearchTerm != undefined){
+                            this.search.val(this.nextSearchTerm);
+                            this.updateResults();
+                            this.search.select();
+                        }
+                    }
+                    this.positionDropdown();
+                } else {
+                    // if nothing left to select close
+                    this.close();
+                    this.search.width(10);
+                }
+            }
+
+            // since its not possible to select an element that has already been
+            // added we do not need to check if this is a new element before firing change
+            this.triggerChange({ added: data });
+
+            if (!options || !options.noFocus)
+                this.focusSearch();
+        },
+
+        // multi
+        cancel: function () {
+            this.close();
+            this.focusSearch();
+        },
+
+        addSelectedChoice: function (data) {
+            var enableChoice = !data.locked,
+                enabledItem = $(
+                    "<li class='select2-search-choice'>" +
+                    "    <div></div>" +
+                    "    <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" +
+                    "</li>"),
+                disabledItem = $(
+                    "<li class='select2-search-choice select2-locked'>" +
+                    "<div></div>" +
+                    "</li>");
+            var choice = enableChoice ? enabledItem : disabledItem,
+                id = this.id(data),
+                val = this.getVal(),
+                formatted,
+                cssClass;
+
+            formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
+            if (formatted != undefined) {
+                choice.find("div").replaceWith($("<div></div>").html(formatted));
+            }
+            cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
+            if (cssClass != undefined) {
+                choice.addClass(cssClass);
+            }
+
+            if(enableChoice){
+              choice.find(".select2-search-choice-close")
+                  .on("mousedown", killEvent)
+                  .on("click dblclick", this.bind(function (e) {
+                  if (!this.isInterfaceEnabled()) return;
+
+                  this.unselect($(e.target));
+                  this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
+                  killEvent(e);
+                  this.close();
+                  this.focusSearch();
+              })).on("focus", this.bind(function () {
+                  if (!this.isInterfaceEnabled()) return;
+                  this.container.addClass("select2-container-active");
+                  this.dropdown.addClass("select2-drop-active");
+              }));
+            }
+
+            choice.data("select2-data", data);
+            choice.insertBefore(this.searchContainer);
+
+            val.push(id);
+            this.setVal(val);
+        },
+
+        // multi
+        unselect: function (selected) {
+            var val = this.getVal(),
+                data,
+                index;
+            selected = selected.closest(".select2-search-choice");
+
+            if (selected.length === 0) {
+                throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
+            }
+
+            data = selected.data("select2-data");
+
+            if (!data) {
+                // prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
+                // and invoked on an element already removed
+                return;
+            }
+
+            var evt = $.Event("select2-removing");
+            evt.val = this.id(data);
+            evt.choice = data;
+            this.opts.element.trigger(evt);
+
+            if (evt.isDefaultPrevented()) {
+                return false;
+            }
+
+            while((index = indexOf(this.id(data), val)) >= 0) {
+                val.splice(index, 1);
+                this.setVal(val);
+                if (this.select) this.postprocessResults();
+            }
+
+            selected.remove();
+
+            this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
+            this.triggerChange({ removed: data });
+
+            return true;
+        },
+
+        // multi
+        postprocessResults: function (data, initial, noHighlightUpdate) {
+            var val = this.getVal(),
+                choices = this.results.find(".select2-result"),
+                compound = this.results.find(".select2-result-with-children"),
+                self = this;
+
+            choices.each2(function (i, choice) {
+                var id = self.id(choice.data("select2-data"));
+                if (indexOf(id, val) >= 0) {
+                    choice.addClass("select2-selected");
+                    // mark all children of the selected parent as selected
+                    choice.find(".select2-result-selectable").addClass("select2-selected");
+                }
+            });
+
+            compound.each2(function(i, choice) {
+                // hide an optgroup if it doesn't have any selectable children
+                if (!choice.is('.select2-result-selectable')
+                    && choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
+                    choice.addClass("select2-selected");
+                }
+            });
+
+            if (this.highlight() == -1 && noHighlightUpdate !== false && this.opts.closeOnSelect === true){
+                self.highlight(0);
+            }
+
+            //If all results are chosen render formatNoMatches
+            if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
+                if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
+                    if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
+                        this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + "</li>");
+                    }
+                }
+            }
+
+        },
+
+        // multi
+        getMaxSearchWidth: function() {
+            return this.selection.width() - getSideBorderPadding(this.search);
+        },
+
+        // multi
+        resizeSearch: function () {
+            var minimumWidth, left, maxWidth, containerLeft, searchWidth,
+                sideBorderPadding = getSideBorderPadding(this.search);
+
+            minimumWidth = measureTextWidth(this.search) + 10;
+
+            left = this.search.offset().left;
+
+            maxWidth = this.selection.width();
+            containerLeft = this.selection.offset().left;
+
+            searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
+
+            if (searchWidth < minimumWidth) {
+                searchWidth = maxWidth - sideBorderPadding;
+            }
+
+            if (searchWidth < 40) {
+                searchWidth = maxWidth - sideBorderPadding;
+            }
+
+            if (searchWidth <= 0) {
+              searchWidth = minimumWidth;
+            }
+
+            this.search.width(Math.floor(searchWidth));
+        },
+
+        // multi
+        getVal: function () {
+            var val;
+            if (this.select) {
+                val = this.select.val();
+                return val === null ? [] : val;
+            } else {
+                val = this.opts.element.val();
+                return splitVal(val, this.opts.separator, this.opts.transformVal);
+            }
+        },
+
+        // multi
+        setVal: function (val) {
+            var unique;
+            if (this.select) {
+                this.select.val(val);
+            } else {
+                unique = [];
+                // filter out duplicates
+                $(val).each(function () {
+                    if (indexOf(this, unique) < 0) unique.push(this);
+                });
+                this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
+            }
+        },
+
+        // multi
+        buildChangeDetails: function (old, current) {
+            var current = current.slice(0),
+                old = old.slice(0);
+
+            // remove intersection from each array
+            for (var i = 0; i < current.length; i++) {
+                for (var j = 0; j < old.length; j++) {
+                    if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
+                        current.splice(i, 1);
+                        if(i>0){
+                            i--;
+                        }
+                        old.splice(j, 1);
+                        j--;
+                    }
+                }
+            }
+
+            return {added: current, removed: old};
+        },
+
+
+        // multi
+        val: function (val, triggerChange) {
+            var oldData, self=this;
+
+            if (arguments.length === 0) {
+                return this.getVal();
+            }
+
+            oldData=this.data();
+            if (!oldData.length) oldData=[];
+
+            // val is an id. !val is true for [undefined,null,'',0] - 0 is legal
+            if (!val && val !== 0) {
+                this.opts.element.val("");
+                this.updateSelection([]);
+                this.clearSearch();
+                if (triggerChange) {
+                    this.triggerChange({added: this.data(), removed: oldData});
+                }
+                return;
+            }
+
+            // val is a list of ids
+            this.setVal(val);
+
+            if (this.select) {
+                this.opts.initSelection(this.select, this.bind(this.updateSelection));
+                if (triggerChange) {
+                    this.triggerChange(this.buildChangeDetails(oldData, this.data()));
+                }
+            } else {
+                if (this.opts.initSelection === undefined) {
+                    throw new Error("val() cannot be called if initSelection() is not defined");
+                }
+
+                this.opts.initSelection(this.opts.element, function(data){
+                    var ids=$.map(data, self.id);
+                    self.setVal(ids);
+                    self.updateSelection(data);
+                    self.clearSearch();
+                    if (triggerChange) {
+                        self.triggerChange(self.buildChangeDetails(oldData, self.data()));
+                    }
+                });
+            }
+            this.clearSearch();
+        },
+
+        // multi
+        onSortStart: function() {
+            if (this.select) {
+                throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
+            }
+
+            // collapse search field into 0 width so its container can be collapsed as well
+            this.search.width(0);
+            // hide the container
+            this.searchContainer.hide();
+        },
+
+        // multi
+        onSortEnd:function() {
+
+            var val=[], self=this;
+
+            // show search and move it to the end of the list
+            this.searchContainer.show();
+            // make sure the search container is the last item in the list
+            this.searchContainer.appendTo(this.searchContainer.parent());
+            // since we collapsed the width in dragStarted, we resize it here
+            this.resizeSearch();
+
+            // update selection
+            this.selection.find(".select2-search-choice").each(function() {
+                val.push(self.opts.id($(this).data("select2-data")));
+            });
+            this.setVal(val);
+            this.triggerChange();
+        },
+
+        // multi
+        data: function(values, triggerChange) {
+            var self=this, ids, old;
+            if (arguments.length === 0) {
+                 return this.selection
+                     .children(".select2-search-choice")
+                     .map(function() { return $(this).data("select2-data"); })
+                     .get();
+            } else {
+                old = this.data();
+                if (!values) { values = []; }
+                ids = $.map(values, function(e) { return self.opts.id(e); });
+                this.setVal(ids);
+                this.updateSelection(values);
+                this.clearSearch();
+                if (triggerChange) {
+                    this.triggerChange(this.buildChangeDetails(old, this.data()));
+                }
+            }
+        }
+    });
+
+    $.fn.select2 = function () {
+
+        var args = Array.prototype.slice.call(arguments, 0),
+            opts,
+            select2,
+            method, value, multiple,
+            allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
+            valueMethods = ["opened", "isFocused", "container", "dropdown"],
+            propertyMethods = ["val", "data"],
+            methodsMap = { search: "externalSearch" };
+
+        this.each(function () {
+            if (args.length === 0 || typeof(args[0]) === "object") {
+                opts = args.length === 0 ? {} : $.extend({}, args[0]);
+                opts.element = $(this);
+
+                if (opts.element.get(0).tagName.toLowerCase() === "select") {
+                    multiple = opts.element.prop("multiple");
+                } else {
+                    multiple = opts.multiple || false;
+                    if ("tags" in opts) {opts.multiple = multiple = true;}
+                }
+
+                select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
+                select2.init(opts);
+            } else if (typeof(args[0]) === "string") {
+
+                if (indexOf(args[0], allowedMethods) < 0) {
+                    throw "Unknown method: " + args[0];
+                }
+
+                value = undefined;
+                select2 = $(this).data("select2");
+                if (select2 === undefined) return;
+
+                method=args[0];
+
+                if (method === "container") {
+                    value = select2.container;
+                } else if (method === "dropdown") {
+                    value = select2.dropdown;
+                } else {
+                    if (methodsMap[method]) method = methodsMap[method];
+
+                    value = select2[method].apply(select2, args.slice(1));
+                }
+                if (indexOf(args[0], valueMethods) >= 0
+                    || (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
+                    return false; // abort the iteration, ready to return first matched value
+                }
+            } else {
+                throw "Invalid arguments to select2 plugin: " + args;
+            }
+        });
+        return (value === undefined) ? this : value;
+    };
+
+    // plugin defaults, accessible to users
+    $.fn.select2.defaults = {
+        width: "copy",
+        loadMorePadding: 0,
+        closeOnSelect: true,
+        openOnEnter: true,
+        containerCss: {},
+        dropdownCss: {},
+        containerCssClass: "",
+        dropdownCssClass: "",
+        formatResult: function(result, container, query, escapeMarkup) {
+            var markup=[];
+            markMatch(this.text(result), query.term, markup, escapeMarkup);
+            return markup.join("");
+        },
+        transformVal: function(val) {
+            return $.trim(val);
+        },
+        formatSelection: function (data, container, escapeMarkup) {
+            return data ? escapeMarkup(this.text(data)) : undefined;
+        },
+        sortResults: function (results, container, query) {
+            return results;
+        },
+        formatResultCssClass: function(data) {return data.css;},
+        formatSelectionCssClass: function(data, container) {return undefined;},
+        minimumResultsForSearch: 0,
+        minimumInputLength: 0,
+        maximumInputLength: null,
+        maximumSelectionSize: 0,
+        id: function (e) { return e == undefined ? null : e.id; },
+        text: function (e) {
+          if (e && this.data && this.data.text) {
+            if ($.isFunction(this.data.text)) {
+              return this.data.text(e);
+            } else {
+              return e[this.data.text];
+            }
+          } else {
+            return e.text;
+          }
+        },
+        matcher: function(term, text) {
+            return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
+        },
+        separator: ",",
+        tokenSeparators: [],
+        tokenizer: defaultTokenizer,
+        escapeMarkup: defaultEscapeMarkup,
+        blurOnChange: false,
+        selectOnBlur: false,
+        adaptContainerCssClass: function(c) { return c; },
+        adaptDropdownCssClass: function(c) { return null; },
+        nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
+        searchInputPlaceholder: '',
+        createSearchChoicePosition: 'top',
+        shouldFocusInput: function (instance) {
+            // Attempt to detect touch devices
+            var supportsTouchEvents = (('ontouchstart' in window) ||
+                                       (navigator.msMaxTouchPoints > 0));
+
+            // Only devices which support touch events should be special cased
+            if (!supportsTouchEvents) {
+                return true;
+            }
+
+            // Never focus the input if search is disabled
+            if (instance.opts.minimumResultsForSearch < 0) {
+                return false;
+            }
+
+            return true;
+        }
+    };
+
+    $.fn.select2.locales = [];
+
+    $.fn.select2.locales['en'] = {
+         formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
+         formatNoMatches: function () { return "No matches found"; },
+         formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
+         formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
+         formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
+         formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
+         formatLoadMore: function (pageNumber) { return "Loading more results…"; },
+         formatSearching: function () { return "Searching…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
+
+    $.fn.select2.ajaxDefaults = {
+        transport: $.ajax,
+        params: {
+            type: "GET",
+            cache: false,
+            dataType: "json"
+        }
+    };
+
+    // exports
+    window.Select2 = {
+        query: {
+            ajax: ajax,
+            local: local,
+            tags: tags
+        }, util: {
+            debounce: debounce,
+            markMatch: markMatch,
+            escapeMarkup: defaultEscapeMarkup,
+            stripDiacritics: stripDiacritics
+        }, "class": {
+            "abstract": AbstractSelect2,
+            "single": SingleSelect2,
+            "multi": MultiSelect2
+        }
+    };
+
+}(jQuery));
diff --git a/core/assets/vendor/select2/select2.min.js b/core/assets/vendor/select2/select2.min.js
new file mode 100644
index 0000000..b56419e
--- /dev/null
+++ b/core/assets/vendor/select2/select2.min.js
@@ -0,0 +1,23 @@
+/*
+Copyright 2014 Igor Vaynberg
+
+Version: 3.5.2 Timestamp: Sat Nov  1 14:43:36 EDT 2014
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License at:
+
+http://www.apache.org/licenses/LICENSE-2.0
+http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the Apache License
+or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
+either express or implied. See the Apache License and the GPL License for the specific language governing
+permissions and limitations under the Apache License and the GPL License.
+*/
+!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"&#92;","&":"&amp;","<":"&lt;",">":"&gt;",'"':"&quot;","'":"&#39;","/":"&#47;"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;
+var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>","   <span class='select2-chosen'>&#160;</span><abbr class='select2-search-choice-close'></abbr>","   <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>","   <div class='select2-search'>","       <label for='' class='select2-offscreen'></label>","       <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'","       aria-autocomplete='list' />","   </div>","   <ul class='select2-results' role='listbox'>","   </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>","  <li class='select2-search-field'>","    <label for='' class='select2-offscreen'></label>","    <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>","  </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>","   <ul class='select2-results'>","   </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length||this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'>    <div></div>    <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text
+},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
\ No newline at end of file
diff --git a/core/assets/vendor/select2/select2.png b/core/assets/vendor/select2/select2.png
new file mode 100644
index 0000000..1d804ff
--- /dev/null
+++ b/core/assets/vendor/select2/select2.png
@@ -0,0 +1,5 @@
+PNG
+
+   IHDR   <   (     ,IDATxKaJ.b]*(Ɉvd<P!RqTСH#GyRدHt0L>9,m)yuم};)IJ,Q(XV&OhF!{n{,%]אGc5x>@3&2%C,bE؀u9=T67)E	"loy[eCÚ
+& Dm#
+QȼŪjބv@TeMܽ;G9b}1̟ǾT: hCf <t;LTAN+^@no-ۏ/Fe0aG3XƏ1(JB[lgpْ.?$8	NZ45d^e0aw!2nA渫`r"ߍoFAغkW <`.R~~J<Sp)پ:tB*}2E|L`WW1{!s-sZ[ضPo|}q    IENDB`
\ No newline at end of file
diff --git a/core/assets/vendor/select2/select2_locale_ar.js b/core/assets/vendor/select2/select2_locale_ar.js
new file mode 100644
index 0000000..e991b72
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_ar.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Arabic translation.
+ *
+ * Author: Adel KEDJOUR <adel@kedjour.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['ar'] = {
+        formatNoMatches: function () { return "لم يتم العثور على مطابقات"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; if (n == 1){ return "الرجاء إدخال حرف واحد على الأكثر"; } return n == 2 ? "الرجاء إدخال حرفين على الأكثر" : "الرجاء إدخال " + n + " على الأكثر"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; if (n == 1){ return "الرجاء إدخال حرف واحد على الأقل"; } return n == 2 ? "الرجاء إدخال حرفين على الأقل" : "الرجاء إدخال " + n + " على الأقل "; },
+        formatSelectionTooBig: function (limit) { if (limit == 1){ return "يمكنك أن تختار إختيار واحد فقط"; } return limit == 2 ? "يمكنك أن تختار إختيارين فقط" : "يمكنك أن تختار " + limit + " إختيارات فقط"; },
+        formatLoadMore: function (pageNumber) { return "تحميل المزيد من النتائج…"; },
+        formatSearching: function () { return "البحث…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['ar']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_az.js b/core/assets/vendor/select2/select2_locale_az.js
new file mode 100644
index 0000000..19fd95b
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_az.js
@@ -0,0 +1,20 @@
+/**
+ * Select2 Azerbaijani translation.
+ *
+ * Author: Farhad Safarov <farhad.safarov@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+     $.fn.select2.locales['az'] = {
+        formatMatches: function (matches) { return matches + " nəticə mövcuddur, hərəkət etdirmək üçün yuxarı və aşağı düymələrindən istifadə edin."; },
+        formatNoMatches: function () { return "Nəticə tapılmadı"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return n + " simvol daxil edin"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return n + " simvol silin"; },
+        formatSelectionTooBig: function (limit) { return "Sadəcə " + limit + " element seçə bilərsiniz"; },
+        formatLoadMore: function (pageNumber) { return "Daha çox nəticə yüklənir…"; },
+        formatSearching: function () { return "Axtarılır…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['az']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_bg.js b/core/assets/vendor/select2/select2_locale_bg.js
new file mode 100644
index 0000000..3283d0a
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_bg.js
@@ -0,0 +1,20 @@
+/**
+ * Select2 Bulgarian translation.
+ * 
+ * @author  Lubomir Vikev <lubomirvikev@gmail.com>
+ * @author  Uriy Efremochkin <efremochkin@uriy.me>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['bg'] = {
+        formatNoMatches: function () { return "Няма намерени съвпадения"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Моля въведете още " + n + " символ" + (n > 1 ? "а" : ""); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Моля въведете с " + n + " по-малко символ" + (n > 1 ? "а" : ""); },
+        formatSelectionTooBig: function (limit) { return "Можете да направите до " + limit + (limit > 1 ? " избора" : " избор"); },
+        formatLoadMore: function (pageNumber) { return "Зареждат се още…"; },
+        formatSearching: function () { return "Търсене…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['bg']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_ca.js b/core/assets/vendor/select2/select2_locale_ca.js
new file mode 100644
index 0000000..dbea39e
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_ca.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Catalan translation.
+ * 
+ * Author: David Planella <david.planella@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['ca'] = {
+        formatNoMatches: function () { return "No s'ha trobat cap coincidència"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; },
+        formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats…"; },
+        formatSearching: function () { return "S'està cercant…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['ca']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_cs.js b/core/assets/vendor/select2/select2_locale_cs.js
new file mode 100644
index 0000000..ef12185
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_cs.js
@@ -0,0 +1,51 @@
+/**
+ * Select2 Czech translation.
+ * 
+ * Author: Michal Marek <ahoj@michal-marek.cz>
+ * Author - sklonovani: David Vallner <david@vallner.net>
+ */
+(function ($) {
+    "use strict";
+    // use text for the numbers 2 through 4
+    var smallNumbers = {
+        2: function(masc) { return (masc ? "dva" : "dvě"); },
+        3: function() { return "tři"; },
+        4: function() { return "čtyři"; }
+    }
+    $.fn.select2.locales['cs'] = {
+        formatNoMatches: function () { return "Nenalezeny žádné položky"; },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            if (n == 1) {
+                return "Prosím zadejte ještě jeden znak";
+            } else if (n <= 4) {
+                return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky";
+            } else {
+                return "Prosím zadejte ještě dalších "+n+" znaků";
+            }
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            if (n == 1) {
+                return "Prosím zadejte o jeden znak méně";
+            } else if (n <= 4) {
+                return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně";
+            } else {
+                return "Prosím zadejte o "+n+" znaků méně";
+            }
+        },
+        formatSelectionTooBig: function (limit) {
+            if (limit == 1) {
+                return "Můžete zvolit jen jednu položku";
+            } else if (limit <= 4) {
+                return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky";
+            } else {
+                return "Můžete zvolit maximálně "+limit+" položek";
+            }
+        },
+        formatLoadMore: function (pageNumber) { return "Načítají se další výsledky…"; },
+        formatSearching: function () { return "Vyhledávání…"; }
+    };
+
+	$.extend($.fn.select2.defaults, $.fn.select2.locales['cs']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_da.js b/core/assets/vendor/select2/select2_locale_da.js
new file mode 100644
index 0000000..702238b
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_da.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Danish translation.
+ *
+ * Author: Anders Jenbo <anders@jenbo.dk>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['da'] = {
+        formatNoMatches: function () { return "Ingen resultater fundet"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; },
+        formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); },
+        formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; },
+        formatSearching: function () { return "Søger…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['da']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_de.js b/core/assets/vendor/select2/select2_locale_de.js
new file mode 100644
index 0000000..e275417
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_de.js
@@ -0,0 +1,18 @@
+/**
+ * Select2 German translation
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['de'] = {
+        formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; },
+        formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; },
+        formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse…"; },
+        formatSearching: function () { return "Suche…"; },
+        formatMatches: function (matches) { return matches + " Ergebnis " + (matches > 1 ? "se" : "") + " verfügbar, zum Navigieren die Hoch-/Runter-Pfeiltasten verwenden."; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['de']);
+})(jQuery);
\ No newline at end of file
diff --git a/core/assets/vendor/select2/select2_locale_el.js b/core/assets/vendor/select2/select2_locale_el.js
new file mode 100644
index 0000000..d17459e
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_el.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Greek translation.
+ * 
+ * @author  Uriy Efremochkin <efremochkin@uriy.me>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['el'] = {
+        formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερο" + (n > 1 ? "υς" : "") + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
+        formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμεν" + (limit > 1 ? "α" : "ο"); },
+        formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων…"; },
+        formatSearching: function () { return "Αναζήτηση…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['el']);
+})(jQuery);
\ No newline at end of file
diff --git a/core/assets/vendor/select2/select2_locale_en.js.template b/core/assets/vendor/select2/select2_locale_en.js.template
new file mode 100644
index 0000000..f758b11
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_en.js.template
@@ -0,0 +1,20 @@
+/**
+ * Select2 <Language> translation.
+ *
+ * Author: Your Name <your@email>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['en'] = {
+        formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
+        formatNoMatches: function () { return "No matches found"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Loading more results…"; },
+        formatSearching: function () { return "Searching…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_es.js b/core/assets/vendor/select2/select2_locale_es.js
new file mode 100644
index 0000000..92a1986
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_es.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Spanish translation
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['es'] = {
+    	formatMatches: function (matches) { if (matches === 1) { return "Un resultado disponible, presione enter para seleccionarlo."; } return matches + " resultados disponibles, use las teclas de dirección para navegar."; },
+        formatNoMatches: function () { return "No se encontraron resultados"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor, introduzca " + n + " car" + (n == 1? "ácter" : "acteres"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor, elimine " + n + " car" + (n == 1? "ácter" : "acteres"); },
+        formatSelectionTooBig: function (limit) { return "Sólo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Cargando más resultados…"; },
+        formatSearching: function () { return "Buscando…"; },
+        formatAjaxError: function() { return "La carga falló"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['es']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_et.js b/core/assets/vendor/select2/select2_locale_et.js
new file mode 100644
index 0000000..4d69f55
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_et.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Estonian translation.
+ *
+ * Author: Kuldar Kalvik <kuldar@kalvik.ee>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['et'] = {
+        formatNoMatches: function () { return "Tulemused puuduvad"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; },
+        formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; },
+        formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; },
+        formatSearching: function () { return "Otsin.."; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['et']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_eu.js b/core/assets/vendor/select2/select2_locale_eu.js
new file mode 100644
index 0000000..67ae8d0
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_eu.js
@@ -0,0 +1,45 @@
+/**
+ * Select2 Basque translation.
+ *
+ * Author: Julen Ruiz Aizpuru <julenx at gmail dot com>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['eu'] = {
+        formatNoMatches: function () {
+          return "Ez da bat datorrenik aurkitu";
+        },
+        formatInputTooShort: function (input, min) {
+          var n = min - input.length;
+          if (n === 1) {
+            return "Idatzi karaktere bat gehiago";
+          } else {
+            return "Idatzi " + n + " karaktere gehiago";
+          }
+        },
+        formatInputTooLong: function (input, max) {
+          var n = input.length - max;
+          if (n === 1) {
+            return "Idatzi karaktere bat gutxiago";
+          } else {
+            return "Idatzi " + n + " karaktere gutxiago";
+          }
+        },
+        formatSelectionTooBig: function (limit) {
+          if (limit === 1 ) {
+            return "Elementu bakarra hauta dezakezu";
+          } else {
+            return limit + " elementu hauta ditzakezu soilik";
+          }
+        },
+        formatLoadMore: function (pageNumber) {
+          return "Emaitza gehiago kargatzen…";
+        },
+        formatSearching: function () {
+          return "Bilatzen…";
+        }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['eu']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_fa.js b/core/assets/vendor/select2/select2_locale_fa.js
new file mode 100644
index 0000000..b3ffd8b
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_fa.js
@@ -0,0 +1,21 @@
+/**
+ * Select2 Persian translation.
+ * 
+ * Author: Ali Choopan <choopan@arsh.co>
+ * Author: Ebrahim Byagowi <ebrahim@gnu.org>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['fa'] = {
+        formatMatches: function (matches) { return matches + " نتیجه موجود است، کلیدهای جهت بالا و پایین را برای گشتن استفاده کنید."; },
+        formatNoMatches: function () { return "نتیجه‌ای یافت نشد."; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "لطفاً " + n + " نویسه بیشتر وارد نمایید"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "لطفاً " + n + " نویسه را حذف کنید."; },
+        formatSelectionTooBig: function (limit) { return "شما فقط می‌توانید " + limit + " مورد را انتخاب کنید"; },
+        formatLoadMore: function (pageNumber) { return "در حال بارگیری موارد بیشتر…"; },
+        formatSearching: function () { return "در حال جستجو…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['fa']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_fi.js b/core/assets/vendor/select2/select2_locale_fi.js
new file mode 100644
index 0000000..6487fbd
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_fi.js
@@ -0,0 +1,30 @@
+/**
+ * Select2 Finnish translation
+ */
+(function ($) {
+    "use strict";
+    $.fn.select2.locales['fi'] = {
+        formatNoMatches: function () {
+            return "Ei tuloksia";
+        },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            return "Ole hyvä ja anna " + n + " merkkiä lisää";
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            return "Ole hyvä ja anna " + n + " merkkiä vähemmän";
+        },
+        formatSelectionTooBig: function (limit) {
+            return "Voit valita ainoastaan " + limit + " kpl";
+        },
+        formatLoadMore: function (pageNumber) {
+            return "Ladataan lisää tuloksia…";
+        },
+        formatSearching: function () {
+            return "Etsitään…";
+        }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['fi']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_fr.js b/core/assets/vendor/select2/select2_locale_fr.js
new file mode 100644
index 0000000..d5485d6
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_fr.js
@@ -0,0 +1,18 @@
+/**
+ * Select2 French translation
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['fr'] = {
+        formatMatches: function (matches) { return matches + " résultats sont disponibles, utilisez les flèches haut et bas pour naviguer."; },
+        formatNoMatches: function () { return "Aucun résultat trouvé"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Saisissez " + n + " caractère" + (n == 1? "" : "s") + " supplémentaire" + (n == 1? "" : "s") ; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Supprimez " + n + " caractère" + (n == 1? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires…"; },
+        formatSearching: function () { return "Recherche en cours…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['fr']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_gl.js b/core/assets/vendor/select2/select2_locale_gl.js
new file mode 100644
index 0000000..9335167
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_gl.js
@@ -0,0 +1,45 @@
+/**
+ * Select2 Galician translation
+ * 
+ * Author: Leandro Regueiro <leandro.regueiro@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['gl'] = {
+        formatNoMatches: function () {
+            return "Non se atoparon resultados";
+        },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            if (n === 1) {
+                return "Engada un carácter";
+            } else {
+                return "Engada " + n + " caracteres";
+            }
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            if (n === 1) {
+                return "Elimine un carácter";
+            } else {
+                return "Elimine " + n + " caracteres";
+            }
+        },
+        formatSelectionTooBig: function (limit) {
+            if (limit === 1 ) {
+                return "Só pode seleccionar un elemento";
+            } else {
+                return "Só pode seleccionar " + limit + " elementos";
+            }
+        },
+        formatLoadMore: function (pageNumber) {
+            return "Cargando máis resultados…";
+        },
+        formatSearching: function () {
+            return "Buscando…";
+        }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['gl']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_he.js b/core/assets/vendor/select2/select2_locale_he.js
new file mode 100644
index 0000000..789dcdc
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_he.js
@@ -0,0 +1,19 @@
+/**
+* Select2 Hebrew translation.
+*
+* Author: Yakir Sitbon <http://www.yakirs.net/>
+*/
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['he'] = {
+        formatNoMatches: function () { return "לא נמצאו התאמות"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; },
+        formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; },
+        formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות…"; },
+        formatSearching: function () { return "מחפש…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['he']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_hr.js b/core/assets/vendor/select2/select2_locale_hr.js
new file mode 100644
index 0000000..ce8051c
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_hr.js
@@ -0,0 +1,24 @@
+/**
+ * Select2 Croatian translation.
+ *
+ * @author  Edi Modrić <edi.modric@gmail.com>
+ * @author  Uriy Efremochkin <efremochkin@uriy.me>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['hr'] = {
+        formatNoMatches: function () { return "Nema rezultata"; },
+        formatInputTooShort: function (input, min) { return "Unesite još" + character(min - input.length); },
+        formatInputTooLong: function (input, max) { return "Unesite" + character(input.length - max) + " manje"; },
+        formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; },
+        formatLoadMore: function (pageNumber) { return "Učitavanje rezultata…"; },
+        formatSearching: function () { return "Pretraga…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['hr']);
+
+    function character (n) {
+        return " " + n + " znak" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "a" : "" : "ova");
+    }
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_hu.js b/core/assets/vendor/select2/select2_locale_hu.js
new file mode 100644
index 0000000..f431f24
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_hu.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Hungarian translation
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['hu'] = {
+        formatNoMatches: function () { return "Nincs találat."; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " karakterrel több, mint kellene."; },
+        formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; },
+        formatLoadMore: function (pageNumber) { return "Töltés…"; },
+        formatSearching: function () { return "Keresés…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['hu']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_id.js b/core/assets/vendor/select2/select2_locale_id.js
new file mode 100644
index 0000000..e9c1fd9
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_id.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Indonesian translation.
+ * 
+ * Author: Ibrahim Yusuf <ibrahim7usuf@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['id'] = {
+        formatNoMatches: function () { return "Tidak ada data yang sesuai"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Mengambil data…"; },
+        formatSearching: function () { return "Mencari…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['id']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_is.js b/core/assets/vendor/select2/select2_locale_is.js
new file mode 100644
index 0000000..273f33d
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_is.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Icelandic translation.
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['is'] = {
+        formatNoMatches: function () { return "Ekkert fannst"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n > 1 ? "i" : "") + " í viðbót"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n > 1 ? "i" : ""); },
+        formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; },
+        formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður…"; },
+        formatSearching: function () { return "Leita…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['is']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_it.js b/core/assets/vendor/select2/select2_locale_it.js
new file mode 100644
index 0000000..6e2b8e2
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_it.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Italian translation
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['it'] = {
+        formatNoMatches: function () { return "Nessuna corrispondenza trovata"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; },
+        formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); },
+        formatLoadMore: function (pageNumber) { return "Caricamento in corso…"; },
+        formatSearching: function () { return "Ricerca…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['it']);
+})(jQuery);
\ No newline at end of file
diff --git a/core/assets/vendor/select2/select2_locale_ja.js b/core/assets/vendor/select2/select2_locale_ja.js
new file mode 100644
index 0000000..7dbd8d7
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_ja.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Japanese translation.
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['ja'] = {
+        formatNoMatches: function () { return "該当なし"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; },
+        formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; },
+        formatLoadMore: function (pageNumber) { return "読込中･･･"; },
+        formatSearching: function () { return "検索中･･･"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['ja']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_ka.js b/core/assets/vendor/select2/select2_locale_ka.js
new file mode 100644
index 0000000..6cbe1d8
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_ka.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Georgian (Kartuli) translation.
+ * 
+ * Author: Dimitri Kurashvili dimakura@gmail.com
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['ka'] = {
+        formatNoMatches: function () { return "ვერ მოიძებნა"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "გთხოვთ შეიყვანოთ კიდევ " + n + " სიმბოლო"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "გთხოვთ წაშალოთ " + n + " სიმბოლო"; },
+        formatSelectionTooBig: function (limit) { return "თქვენ შეგიძლიათ მხოლოდ " + limit + " ჩანაწერის მონიშვნა"; },
+        formatLoadMore: function (pageNumber) { return "შედეგის ჩატვირთვა…"; },
+        formatSearching: function () { return "ძებნა…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['ka']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_ko.js b/core/assets/vendor/select2/select2_locale_ko.js
new file mode 100644
index 0000000..bf036e0
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_ko.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Korean translation.
+ * 
+ * @author  Swen Mun <longfinfunnel@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['ko'] = {
+        formatNoMatches: function () { return "결과 없음"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; },
+        formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; },
+        formatLoadMore: function (pageNumber) { return "불러오는 중…"; },
+        formatSearching: function () { return "검색 중…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['ko']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_lt.js b/core/assets/vendor/select2/select2_locale_lt.js
new file mode 100644
index 0000000..7d7040f
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_lt.js
@@ -0,0 +1,26 @@
+/**
+ * Select2 Lithuanian translation.
+ * 
+ * @author  CRONUS Karmalakas <cronus dot karmalakas at gmail dot com>
+ * @author  Uriy Efremochkin <efremochkin@uriy.me>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['lt'] = {
+        formatNoMatches: function () { return "Atitikmenų nerasta"; },
+        formatInputTooShort: function (input, min) { return "Įrašykite dar" + character(min - input.length); },
+        formatInputTooLong: function (input, max) { return "Pašalinkite" + character(input.length - max); },
+        formatSelectionTooBig: function (limit) {
+        	return "Jūs galite pasirinkti tik " + limit + " element" + ((limit%100 > 9 && limit%100 < 21) || limit%10 == 0 ? "ų" : limit%10 > 1 ? "us" : "ą");
+        },
+        formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų…"; },
+        formatSearching: function () { return "Ieškoma…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['lt']);
+
+    function character (n) {
+        return " " + n + " simbol" + ((n%100 > 9 && n%100 < 21) || n%10 == 0 ? "ių" : n%10 > 1 ? "ius" : "į");
+    }
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_lv.js b/core/assets/vendor/select2/select2_locale_lv.js
new file mode 100644
index 0000000..4afc5b4
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_lv.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Latvian translation.
+ *
+ * @author  Uriy Efremochkin <efremochkin@uriy.me>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['lv'] = {
+        formatNoMatches: function () { return "Sakritību nav"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : n%10 == 1 ? "u" : "us"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : n%10 == 1 ? "u" : "iem") + " mazāk"; },
+        formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : limit%10 == 1 ? "u" : "us"); },
+        formatLoadMore: function (pageNumber) { return "Datu ielāde…"; },
+        formatSearching: function () { return "Meklēšana…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['lv']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_mk.js b/core/assets/vendor/select2/select2_locale_mk.js
new file mode 100644
index 0000000..8a51a9e
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_mk.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Macedonian translation.
+ * 
+ * Author: Marko Aleksic <psybaron@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['mk'] = {
+        formatNoMatches: function () { return "Нема пронајдено совпаѓања"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); },
+        formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); },
+        formatLoadMore: function (pageNumber) { return "Вчитување резултати…"; },
+        formatSearching: function () { return "Пребарување…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['mk']);
+})(jQuery);
\ No newline at end of file
diff --git a/core/assets/vendor/select2/select2_locale_ms.js b/core/assets/vendor/select2/select2_locale_ms.js
new file mode 100644
index 0000000..46588d6
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_ms.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Malay translation.
+ * 
+ * Author: Kepoweran <kepoweran@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['ms'] = {
+        formatNoMatches: function () { return "Tiada padanan yang ditemui"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Sila masukkan " + n + " aksara lagi"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Sila hapuskan " + n + " aksara"; },
+        formatSelectionTooBig: function (limit) { return "Anda hanya boleh memilih " + limit + " pilihan"; },
+        formatLoadMore: function (pageNumber) { return "Sedang memuatkan keputusan…"; },
+        formatSearching: function () { return "Mencari…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['ms']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_nb.js b/core/assets/vendor/select2/select2_locale_nb.js
new file mode 100644
index 0000000..cb5dfae
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_nb.js
@@ -0,0 +1,22 @@
+/**
+ * Select2 Norwegian Bokmål translation.
+ *
+ * Author: Torgeir Veimo <torgeir.veimo@gmail.com>
+ * Author: Bjørn Johansen <post@bjornjohansen.no>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['nb'] = {
+        formatMatches: function (matches) { if (matches === 1) { return "Ett resultat er tilgjengelig, trykk enter for å velge det."; } return matches + " resultater er tilgjengelig. Bruk piltastene opp og ned for å navigere."; },
+        formatNoMatches: function () { return "Ingen treff"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; },
+        formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; },
+        formatLoadMore: function (pageNumber) { return "Laster flere resultater …"; },
+        formatSearching: function () { return "Søker …"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['no']);
+})(jQuery);
+
diff --git a/core/assets/vendor/select2/select2_locale_nl.js b/core/assets/vendor/select2/select2_locale_nl.js
new file mode 100644
index 0000000..985741e
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_nl.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Dutch translation
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['nl'] = {
+        formatNoMatches: function () { return "Geen resultaten gevonden"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul nog " + n + " karakter" + (n == 1? "" : "s") + " in"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Haal " + n + " karakter" + (n == 1? "" : "s") + " weg"; },
+        formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; },
+        formatLoadMore: function (pageNumber) { return "Meer resultaten laden…"; },
+        formatSearching: function () { return "Zoeken…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['nl']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_pl.js b/core/assets/vendor/select2/select2_locale_pl.js
new file mode 100644
index 0000000..87c2619
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_pl.js
@@ -0,0 +1,54 @@
+/**
+ * Select2 Polish translation.
+ *
+ * @author  Jan Kondratowicz <jan@kondratowicz.pl>
+ * @author  Uriy Efremochkin <efremochkin@uriy.me>
+ * @author  Michał Połtyn <mike@poltyn.com>
+ * @author  Damian Zajkowski <damian.zajkowski@gmail.com>
+ */
+(function($) {
+    "use strict";
+
+    $.fn.select2.locales['pl'] = {
+        formatNoMatches: function() {
+            return "Brak wyników";
+        },
+        formatInputTooShort: function(input, min) {
+            return "Wpisz co najmniej" + character(min - input.length, "znak", "i");
+        },
+        formatInputTooLong: function(input, max) {
+            return "Wpisana fraza jest za długa o" + character(input.length - max, "znak", "i");
+        },
+        formatSelectionTooBig: function(limit) {
+            return "Możesz zaznaczyć najwyżej" + character(limit, "element", "y");
+        },
+        formatLoadMore: function(pageNumber) {
+            return "Ładowanie wyników…";
+        },
+        formatSearching: function() {
+            return "Szukanie…";
+        }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['pl']);
+
+    function character(n, word, pluralSuffix) {
+        //Liczba pojedyncza - brak suffiksu
+        //jeden znak
+        //jeden element
+        var suffix = '';
+        if (n > 1 && n < 5) {
+            //Liczaba mnoga ilość od 2 do 4 - własny suffiks
+            //Dwa znaki, trzy znaki, cztery znaki.
+            //Dwa elementy, trzy elementy, cztery elementy
+            suffix = pluralSuffix;
+        } else if (n == 0 || n >= 5) {
+            //Ilość 0 suffiks ów
+            //Liczaba mnoga w ilości 5 i więcej - suffiks ów (nie poprawny dla wszystkich wyrazów, np. 100 wiadomości)
+            //Zero znaków, Pięć znaków, sześć znaków, siedem znaków, osiem znaków.
+            //Zero elementów Pięć elementów, sześć elementów, siedem elementów, osiem elementów.
+            suffix = 'ów';
+        }
+        return " " + n + " " + word + suffix;
+    }
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_pt-BR.js b/core/assets/vendor/select2/select2_locale_pt-BR.js
new file mode 100644
index 0000000..51b037d
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_pt-BR.js
@@ -0,0 +1,18 @@
+/**
+ * Select2 Brazilian Portuguese translation
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['pt-BR'] = {
+        formatNoMatches: function () { return "Nenhum resultado encontrado"; },
+        formatAjaxError: function () { return "Erro na busca"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Digite " + (min == 1 ? "" : "mais") + " " + n + " caracter" + (n == 1? "" : "es"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caracter" + (n == 1? "" : "es"); },
+        formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Carregando mais resultados…"; },
+        formatSearching: function () { return "Buscando…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['pt-BR']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_pt-PT.js b/core/assets/vendor/select2/select2_locale_pt-PT.js
new file mode 100644
index 0000000..ae55a4f
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_pt-PT.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Portuguese (Portugal) translation
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['pt-PT'] = {
+        formatNoMatches: function () { return "Nenhum resultado encontrado"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
+        formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "A carregar mais resultados…"; },
+        formatSearching: function () { return "A pesquisar…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['pt-PT']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_ro.js b/core/assets/vendor/select2/select2_locale_ro.js
new file mode 100644
index 0000000..21b0cf1
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_ro.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Romanian translation.
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['ro'] = {
+        formatNoMatches: function () { return "Nu a fost găsit nimic"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); },
+        formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); },
+        formatLoadMore: function (pageNumber) { return "Se încarcă…"; },
+        formatSearching: function () { return "Căutare…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['ro']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_rs.js b/core/assets/vendor/select2/select2_locale_rs.js
new file mode 100644
index 0000000..72c1638
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_rs.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Serbian translation.
+ *
+ * @author  Limon Monte <limon.monte@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['rs'] = {
+        formatNoMatches: function () { return "Ništa nije pronađeno"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Ukucajte bar još " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Obrišite " + n + " simbol" + (n % 10 == 1 && n % 100 != 11	 ? "" : "a"); },
+        formatSelectionTooBig: function (limit) { return "Možete izabrati samo " + limit + " stavk" + (limit % 10 == 1 && limit % 100 != 11	 ? "u" : (limit % 10 >= 2 && limit % 10 <= 4 && (limit % 100 < 12 || limit % 100 > 14)? "e" : "i")); },
+        formatLoadMore: function (pageNumber) { return "Preuzimanje još rezultata…"; },
+        formatSearching: function () { return "Pretraga…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['rs']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_ru.js b/core/assets/vendor/select2/select2_locale_ru.js
new file mode 100644
index 0000000..2a6c770
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_ru.js
@@ -0,0 +1,23 @@
+/**
+ * Select2 Russian translation.
+ *
+ * @author  Uriy Efremochkin <efremochkin@uriy.me>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['ru'] = {
+        formatNoMatches: function () { return "Совпадений не найдено"; },
+        formatInputTooShort: function (input, min) { return "Пожалуйста, введите еще хотя бы" + character(min - input.length); },
+        formatInputTooLong: function (input, max) { return "Пожалуйста, введите на" + character(input.length - max) + " меньше"; },
+        formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit%10 == 1 && limit%100 != 11 ? "а" : "ов"); },
+        formatLoadMore: function (pageNumber) { return "Загрузка данных…"; },
+        formatSearching: function () { return "Поиск…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['ru']);
+
+    function character (n) {
+        return " " + n + " символ" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 20) ? n%10 > 1 ? "a" : "" : "ов");
+    }
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_sk.js b/core/assets/vendor/select2/select2_locale_sk.js
new file mode 100644
index 0000000..027530c
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_sk.js
@@ -0,0 +1,50 @@
+/**
+ * Select2 Slovak translation.
+ *
+ * Author: David Vallner <david@vallner.net>
+ */
+(function ($) {
+    "use strict";
+    // use text for the numbers 2 through 4
+    var smallNumbers = {
+        2: function(masc) { return (masc ? "dva" : "dve"); },
+        3: function() { return "tri"; },
+        4: function() { return "štyri"; }
+    };
+    $.fn.select2.locales['sk'] = {
+        formatNoMatches: function () { return "Nenašli sa žiadne položky"; },
+        formatInputTooShort: function (input, min) {
+            var n = min - input.length;
+            if (n == 1) {
+                return "Prosím, zadajte ešte jeden znak";
+            } else if (n <= 4) {
+                return "Prosím, zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky";
+            } else {
+                return "Prosím, zadajte ešte ďalších "+n+" znakov";
+            }
+        },
+        formatInputTooLong: function (input, max) {
+            var n = input.length - max;
+            if (n == 1) {
+                return "Prosím, zadajte o jeden znak menej";
+            } else if (n >= 2 && n <= 4) {
+                return "Prosím, zadajte o "+smallNumbers[n](true)+" znaky menej";
+            } else {
+                return "Prosím, zadajte o "+n+" znakov menej";
+            }
+        },
+        formatSelectionTooBig: function (limit) {
+            if (limit == 1) {
+                return "Môžete zvoliť len jednu položku";
+            } else if (limit >= 2 && limit <= 4) {
+                return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky";
+            } else {
+                return "Môžete zvoliť najviac "+limit+" položiek";
+            }
+        },
+        formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky…"; },
+        formatSearching: function () { return "Vyhľadávanie…"; }
+    };
+
+	$.extend($.fn.select2.defaults, $.fn.select2.locales['sk']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_sv.js b/core/assets/vendor/select2/select2_locale_sv.js
new file mode 100644
index 0000000..96f8c0a
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_sv.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Swedish translation.
+ *
+ * Author: Jens Rantil <jens.rantil@telavox.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['sv'] = {
+        formatNoMatches: function () { return "Inga träffar"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; },
+        formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; },
+        formatLoadMore: function (pageNumber) { return "Laddar fler resultat…"; },
+        formatSearching: function () { return "Söker…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['sv']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_th.js b/core/assets/vendor/select2/select2_locale_th.js
new file mode 100644
index 0000000..7f3e6ef
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_th.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Thai translation.
+ *
+ * Author: Atsawin Chaowanakritsanakul <joke@nakhon.net>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['th'] = {
+        formatNoMatches: function () { return "ไม่พบข้อมูล"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "โปรดพิมพ์เพิ่มอีก " + n + " ตัวอักษร"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "โปรดลบออก " + n + " ตัวอักษร"; },
+        formatSelectionTooBig: function (limit) { return "คุณสามารถเลือกได้ไม่เกิน " + limit + " รายการ"; },
+        formatLoadMore: function (pageNumber) { return "กำลังค้นข้อมูลเพิ่ม…"; },
+        formatSearching: function () { return "กำลังค้นข้อมูล…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['th']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_tr.js b/core/assets/vendor/select2/select2_locale_tr.js
new file mode 100644
index 0000000..1dda95c
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_tr.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Turkish translation.
+ * 
+ * Author: Salim KAYABAŞI <salim.kayabasi@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['tr'] = {
+        formatNoMatches: function () { return "Sonuç bulunamadı"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; },
+        formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; },
+        formatLoadMore: function (pageNumber) { return "Daha fazla…"; },
+        formatSearching: function () { return "Aranıyor…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['tr']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_ug-CN.js b/core/assets/vendor/select2/select2_locale_ug-CN.js
new file mode 100644
index 0000000..579588a
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_ug-CN.js
@@ -0,0 +1,16 @@
+/**
+ * Select2 Uyghur translation
+ */
+(function ($) {
+    "use strict";
+    $.fn.select2.locales['ug-CN'] = {
+        formatNoMatches: function () { return "ماس كېلىدىغان ئۇچۇر تېپىلمىدى"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "يەنە " + n + " ھەرپ كىرگۈزۈڭ";},
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "" + n + "ھەرپ ئۆچۈرۈڭ";},
+        formatSelectionTooBig: function (limit) { return "ئەڭ كۆپ بولغاندا" + limit + " تال ئۇچۇر تاللىيالايسىز"; },
+        formatLoadMore: function (pageNumber) { return "ئۇچۇرلار ئوقۇلىۋاتىدۇ…"; },
+        formatSearching: function () { return "ئىزدەۋاتىدۇ…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['ug-CN']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_uk.js b/core/assets/vendor/select2/select2_locale_uk.js
new file mode 100644
index 0000000..b5bd0e0
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_uk.js
@@ -0,0 +1,25 @@
+/**
+ * Select2 Ukrainian translation.
+ * 
+ * @author  bigmihail <bigmihail@bigmir.net>
+ * @author  Uriy Efremochkin <efremochkin@uriy.me>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['uk'] = {
+        formatMatches: function (matches) { return character(matches, "результат") + " знайдено, використовуйте клавіші зі стрілками вверх та вниз для навігації."; },
+        formatNoMatches: function () { return "Нічого не знайдено"; },
+        formatInputTooShort: function (input, min) { return "Введіть буль ласка ще " + character(min - input.length, "символ"); },
+        formatInputTooLong: function (input, max) { return "Введіть буль ласка на " + character(input.length - max, "символ") + " менше"; },
+        formatSelectionTooBig: function (limit) { return "Ви можете вибрати лише " + character(limit, "елемент"); },
+        formatLoadMore: function (pageNumber) { return "Завантаження даних…"; },
+        formatSearching: function () { return "Пошук…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['uk']);
+
+    function character (n, word) {
+        return n + " " + word + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "и" : "" : "ів");
+    }
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_vi.js b/core/assets/vendor/select2/select2_locale_vi.js
new file mode 100644
index 0000000..cc67065
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_vi.js
@@ -0,0 +1,20 @@
+/**
+ * Select2 Vietnamese translation.
+ * 
+ * Author: Long Nguyen <olragon@gmail.com>
+ */
+(function ($) {
+    "use strict";
+
+    $.fn.select2.locales['vi'] = {
+        formatNoMatches: function () { return "Không tìm thấy kết quả"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); },
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); },
+        formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); },
+        formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả…"; },
+        formatSearching: function () { return "Đang tìm…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['vi']);
+})(jQuery);
+
diff --git a/core/assets/vendor/select2/select2_locale_zh-CN.js b/core/assets/vendor/select2/select2_locale_zh-CN.js
new file mode 100644
index 0000000..e988dac
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_zh-CN.js
@@ -0,0 +1,16 @@
+/**
+ * Select2 Chinese translation
+ */
+(function ($) {
+    "use strict";
+    $.fn.select2.locales['zh-CN'] = {
+        formatNoMatches: function () { return "没有找到匹配项"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";},
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";},
+        formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; },
+        formatLoadMore: function (pageNumber) { return "加载结果中…"; },
+        formatSearching: function () { return "搜索中…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['zh-CN']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2_locale_zh-TW.js b/core/assets/vendor/select2/select2_locale_zh-TW.js
new file mode 100644
index 0000000..85dbd5a
--- /dev/null
+++ b/core/assets/vendor/select2/select2_locale_zh-TW.js
@@ -0,0 +1,16 @@
+/**
+ * Select2 Traditional Chinese translation
+ */
+(function ($) {
+    "use strict";
+    $.fn.select2.locales['zh-TW'] = {
+        formatNoMatches: function () { return "沒有找到相符的項目"; },
+        formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";},
+        formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";},
+        formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; },
+        formatLoadMore: function (pageNumber) { return "載入中…"; },
+        formatSearching: function () { return "搜尋中…"; }
+    };
+
+    $.extend($.fn.select2.defaults, $.fn.select2.locales['zh-TW']);
+})(jQuery);
diff --git a/core/assets/vendor/select2/select2x2.png b/core/assets/vendor/select2/select2x2.png
new file mode 100644
index 0000000..4bdd5c9
--- /dev/null
+++ b/core/assets/vendor/select2/select2x2.png
@@ -0,0 +1,6 @@
+PNG
+
+   IHDR   x   P   қ  IDATx흱nA@#A	C%\P'  Q!AutD+-n\$4Zf8nw+])r✃o `h5='KA8	%7A)\%!q&DO\
+,{H.)^S7=Ȣ:du"րi} %E>ts"|גP?sBQ5c!ysg8"e-dn61~,YTp6zCub Gp}y:J@p7kԣ JR {Y2w/,uO˓Sw5Z%}kphhqɱ96)\%!q>F8<aLp<e%,T%+@@':	&o`@s7 `@0 C2a"Tjҏejy%aGu~	u Z\7>G+WwXx$V.E(<`Q¶{a~(|sjF<\%k'KAT+y
+^pOI>.
+%{'cJkx!x'?lKSoZ_-	J.tp7AL=[/AደUrwB!xJ~~ogS\E`AC5P"qabl cP$#]`Ӓl]pZr`ӂӒl\p(I+%x`@11&(mW    IENDB`
\ No newline at end of file
diff --git a/core/core.libraries.yml b/core/core.libraries.yml
index 41406af..b259302 100644
--- a/core/core.libraries.yml
+++ b/core/core.libraries.yml
@@ -91,7 +91,7 @@ drupal.autocomplete:
     - core/drupal
     - core/drupalSettings
     - core/drupal.ajax
-    - core/jquery.ui.autocomplete
+    - core/select2
 
 drupal.batch:
   version: VERSION
@@ -797,3 +797,19 @@ underscore:
     gpl-compatible: true
   js:
     assets/vendor/underscore/underscore.js: { weight: -20 }
+
+select2:
+  remote: https://github.com/ivaynberg/select2
+  version: 3.5.2
+  license:
+    name: GNU-GPL-2.0-or-later
+    url: https://github.com/ivaynberg/select2/blob/master/LICENSE
+    gpl-compatible: true
+  js:
+    assets/vendor/select2/select2.js: {}
+    misc/select2.js: {}
+  css:
+    theme:
+      assets/vendor/select2/select2.css: {}
+  dependencies:
+    - core/jquery
diff --git a/core/lib/Drupal/Core/Installer/Form/SelectLanguageForm.php b/core/lib/Drupal/Core/Installer/Form/SelectLanguageForm.php
index 79d9082..0e67b5e 100644
--- a/core/lib/Drupal/Core/Installer/Form/SelectLanguageForm.php
+++ b/core/lib/Drupal/Core/Installer/Form/SelectLanguageForm.php
@@ -67,6 +67,8 @@ public function buildForm(array $form, FormStateInterface $form_state, $install_
       '#options' => $select_options,
       // Use the browser detected language as default or English if nothing found.
       '#default_value' => !empty($browser_langcode) ? $browser_langcode : 'en',
+      // Use the Select2 library.
+      '#select2' => TRUE,
     );
     $form['help'] = array(
       '#type' => 'item',
diff --git a/core/lib/Drupal/Core/Installer/Form/SiteConfigureForm.php b/core/lib/Drupal/Core/Installer/Form/SiteConfigureForm.php
index 1674211..3449ec5 100644
--- a/core/lib/Drupal/Core/Installer/Form/SiteConfigureForm.php
+++ b/core/lib/Drupal/Core/Installer/Form/SiteConfigureForm.php
@@ -200,6 +200,8 @@ public function buildForm(array $form, FormStateInterface $form_state) {
       '#description' => $this->t('By default, dates in this site will be displayed in the chosen time zone.'),
       '#weight' => 5,
       '#attributes' => array('class' => array('timezone-detect')),
+      // Use the Select2 library.
+      '#select2' => TRUE,
     );
 
     $form['update_notifications'] = array(
diff --git a/core/lib/Drupal/Core/Render/Element/FormElement.php b/core/lib/Drupal/Core/Render/Element/FormElement.php
index 401c850..3027540 100644
--- a/core/lib/Drupal/Core/Render/Element/FormElement.php
+++ b/core/lib/Drupal/Core/Render/Element/FormElement.php
@@ -7,6 +7,7 @@
 
 namespace Drupal\Core\Render\Element;
 
+use Drupal\Component\Serialization\Json;
 use Drupal\Core\Form\FormStateInterface;
 
 /**
@@ -128,4 +129,43 @@ public static function processAutocomplete(&$element, FormStateInterface $form_s
     return $element;
   }
 
+  /**
+   * Integrates form elements with the Select2 JavaScript library.
+   *
+   * @param array $element
+   *   The form element to process. Properties used:
+   *   - #select2: Whether to use the Select2 library for this form element. If
+   *     the value is TRUE, the Select2 library is initialized with its default
+   *     options. If the value is an array, each key and value will map to the
+   *     corresponding Select2 configuration.
+   *     @see http://ivaynberg.github.io/select2/#documentation for the list of
+   *     possible configuration options.
+   * @param \Drupal\Core\Form\FormStateInterface $form_state
+   *   The current state of the form.
+   * @param array $complete_form
+   *   The complete form structure.
+   *
+   * @return array
+   *   The form element.
+   */
+  public static function processSelect2(&$element, FormStateInterface $form_state, &$complete_form) {
+    if (!empty($element['#select2'])) {
+      // Provide some default options.
+      // @todo Figure out if we need more defaults here.
+      $configuration = array(
+        'width' => 'resolve',
+      );
+      if (is_array($element['#select2'])) {
+        $configuration = $element['#select2'] + $configuration;
+      }
+
+      $element['#attributes']['class'][] = 'form-select2';
+      $element['#attached']['library'][] = 'core/select2';
+      // Provide a data attribute which stores the Select2 configuration array.
+      $element['#attributes']['data-drupal-select2'] = Json::encode($configuration);
+    }
+
+    return $element;
+  }
+
 }
diff --git a/core/lib/Drupal/Core/Render/Element/Select.php b/core/lib/Drupal/Core/Render/Element/Select.php
index 70f14d6..4507fdb 100644
--- a/core/lib/Drupal/Core/Render/Element/Select.php
+++ b/core/lib/Drupal/Core/Render/Element/Select.php
@@ -31,6 +31,9 @@ public function getInfo() {
       '#process' => array(
         array($class, 'processSelect'),
         array($class, 'processAjaxForm'),
+        // Not to be confused with the processor above, this one is about the
+        // Select2 Javascript library.
+        array($class, 'processSelect2'),
       ),
       '#pre_render' => array(
         array($class, 'preRenderSelect'),
diff --git a/core/misc/autocomplete.js b/core/misc/autocomplete.js
index af64521..dfe5350 100644
--- a/core/misc/autocomplete.js
+++ b/core/misc/autocomplete.js
@@ -2,171 +2,7 @@
 
   "use strict";
 
-  var autocomplete;
-
-  /**
-   * Helper splitting terms from the autocomplete value.
-   *
-   * @param {String} value
-   *
-   * @return {Array}
-   */
-  function autocompleteSplitValues(value) {
-    // We will match the value against comma-separated terms.
-    var result = [];
-    var quote = false;
-    var current = '';
-    var valueLength = value.length;
-    var i, character;
-
-    for (i = 0; i < valueLength; i++) {
-      character = value.charAt(i);
-      if (character === '"') {
-        current += character;
-        quote = !quote;
-      }
-      else if (character === ',' && !quote) {
-        result.push(current.trim());
-        current = '';
-      }
-      else {
-        current += character;
-      }
-    }
-    if (value.length > 0) {
-      result.push($.trim(current));
-    }
-
-    return result;
-  }
-
-  /**
-   * Returns the last value of an multi-value textfield.
-   *
-   * @param {String} terms
-   *
-   * @return {String}
-   */
-  function extractLastTerm(terms) {
-    return autocomplete.splitValues(terms).pop();
-  }
-
-  /**
-   * The search handler is called before a search is performed.
-   *
-   * @param {Object} event
-   *
-   * @return {Boolean}
-   */
-  function searchHandler(event) {
-    // Only search when the term is two characters or larger.
-    var term = autocomplete.extractLastTerm(event.target.value);
-    return term.length >= autocomplete.minLength;
-  }
-
-  /**
-   * jQuery UI autocomplete source callback.
-   *
-   * @param {Object} request
-   * @param {Function} response
-   */
-  function sourceData(request, response) {
-    /*jshint validthis:true */
-    var elementId = this.element.attr('id');
-
-    if (!(elementId in autocomplete.cache)) {
-      autocomplete.cache[elementId] = {};
-    }
-
-    /**
-     * Filter through the suggestions removing all terms already tagged and
-     * display the available terms to the user.
-     *
-     * @param {Object} suggestions
-     */
-    function showSuggestions(suggestions) {
-      var tagged = autocomplete.splitValues(request.term);
-      for (var i = 0, il = tagged.length; i < il; i++) {
-        var index = suggestions.indexOf(tagged[i]);
-        if (index >= 0) {
-          suggestions.splice(index, 1);
-        }
-      }
-      response(suggestions);
-    }
-
-    /**
-     * Transforms the data object into an array and update autocomplete results.
-     *
-     * @param {Object} data
-     */
-    function sourceCallbackHandler(data) {
-      autocomplete.cache[elementId][term] = data;
-
-      // Send the new string array of terms to the jQuery UI list.
-      showSuggestions(data);
-    }
-
-    // Get the desired term and construct the autocomplete URL for it.
-    var term = autocomplete.extractLastTerm(request.term);
-
-    // Check if the term is already cached.
-    if (autocomplete.cache[elementId].hasOwnProperty(term)) {
-      showSuggestions(autocomplete.cache[elementId][term]);
-    }
-    else {
-      var options = $.extend({ success: sourceCallbackHandler, data: { q: term } }, autocomplete.ajax);
-      /*jshint validthis:true */
-      $.ajax(this.element.attr('data-autocomplete-path'), options);
-    }
-  }
-
-  /**
-   * Handles an autocompletefocus event.
-   *
-   * @return {Boolean}
-   */
-  function focusHandler() {
-    return false;
-  }
-
-  /**
-   * Handles an autocompleteselect event.
-   *
-   * @param {Object} event
-   * @param {Object} ui
-   *
-   * @return {Boolean}
-   */
-  function selectHandler(event, ui) {
-    var terms = autocomplete.splitValues(event.target.value);
-    // Remove the current input.
-    terms.pop();
-    // Add the selected item.
-    if (ui.item.value.search(",") > 0) {
-      terms.push('"' + ui.item.value + '"');
-    }
-    else {
-      terms.push(ui.item.value);
-    }
-    event.target.value = terms.join(', ');
-    // Return false to tell jQuery UI that we've filled in the value already.
-    return false;
-  }
-
-  /**
-   * Override jQuery UI _renderItem function to output HTML by default.
-   *
-   * @param {Object} ul
-   * @param {Object} item
-   *
-   * @return {Object}
-   */
-  function renderItem(ul, item) {
-    return $("<li>")
-      .append($("<a>").html(item.label))
-      .appendTo(ul);
-  }
+  var select2Options = {};
 
   /**
    * Attaches the autocomplete behavior to all required fields.
@@ -174,45 +10,42 @@
   Drupal.behaviors.autocomplete = {
     attach: function (context) {
       // Act on textfields with the "form-autocomplete" class.
-      var $autocomplete = $(context).find('input.form-autocomplete').once('autocomplete');
-      if ($autocomplete.length) {
-        // Use jQuery UI Autocomplete on the textfield.
-        $autocomplete.autocomplete(autocomplete.options)
-          .data("ui-autocomplete")
-          ._renderItem = autocomplete.options.renderItem;
-      }
-    },
-    detach: function (context, settings, trigger) {
-      if (trigger === 'unload') {
-        $(context).find('input.form-autocomplete')
-          .removeOnce('autocomplete')
-          .autocomplete('destroy');
-      }
+      var $autocomplete = $(context).find('input.form-autocomplete').once('autocomplete')
+        .each(function () {
+          $(this).select2({
+            tokenSeparators: [","],
+            tags: [],
+            minimumInputLength: 1,
+            quietMills: 200,
+            cache: true,
+            width: 'resolve',
+            initSelection: function (element, callback) {
+              var data = element.val().split(',').map(function (value) {
+                return {id: value, text: value};
+              });
+              callback(data);
+            },
+            createSearchChoice: function (term) {
+              return {id: term, text: term};
+            },
+            ajax: {
+              dataType: 'json',
+              url: $(this).attr('data-autocomplete-path'),
+              data: function (term, page) {
+                return {q: term};
+              },
+              results: function (data, page) {
+                return {
+                  // Transform Drupal autocomplete format to select2 format.
+                  results: data.map(function (result) {
+                    return {id: result.value, text: result.label};
+                  })
+                };
+              }
+            }
+          });
+        });
     }
   };
 
-  /**
-   * Autocomplete object implementation.
-   */
-  autocomplete = {
-    cache: {},
-    // Exposes methods to allow overriding by contrib.
-    minLength: 1,
-    splitValues: autocompleteSplitValues,
-    extractLastTerm: extractLastTerm,
-    // jQuery UI autocomplete options.
-    options: {
-      source: sourceData,
-      focus: focusHandler,
-      search: searchHandler,
-      select: selectHandler,
-      renderItem: renderItem
-    },
-    ajax: {
-      dataType: 'json'
-    }
-  };
-
-  Drupal.autocomplete = autocomplete;
-
 })(jQuery, Drupal);
diff --git a/core/misc/drupal.js b/core/misc/drupal.js
index dcfad00..ccb88c4 100644
--- a/core/misc/drupal.js
+++ b/core/misc/drupal.js
@@ -86,12 +86,12 @@ if (window.jQuery) {
     for (i in behaviors) {
       if (behaviors.hasOwnProperty(i) && typeof behaviors[i].attach === 'function') {
         // Don't stop the execution of behaviors in case of an error.
-        try {
+        //try {
           behaviors[i].attach(context, settings);
-        }
-        catch (e) {
-          errors.push({ behavior: i, error: e });
-        }
+        //}
+        //catch (e) {
+          //errors.push({ behavior: i, error: e });
+        //}
       }
     }
     // Once all behaviors have been processed, inform the user about errors.
diff --git a/core/misc/select2.js b/core/misc/select2.js
new file mode 100644
index 0000000..db320ec
--- /dev/null
+++ b/core/misc/select2.js
@@ -0,0 +1,17 @@
+(function ($, Drupal) {
+
+  "use strict";
+
+  /**
+   * Attaches the Select2 behavior to all form elements that requested it.
+   */
+  Drupal.behaviors.select2 = {
+    attach: function (context) {
+      $(context).find('[data-drupal-select2]').once('drupal-select2')
+        .each(function () {
+          $(this).select2(JSON.parse(this.getAttribute('data-drupal-select2')));
+        });
+    }
+  };
+
+})(jQuery, Drupal);
diff --git a/core/modules/system/src/Form/RegionalForm.php b/core/modules/system/src/Form/RegionalForm.php
index 2d3934f..0550370 100644
--- a/core/modules/system/src/Form/RegionalForm.php
+++ b/core/modules/system/src/Form/RegionalForm.php
@@ -98,6 +98,8 @@ public function buildForm(array $form, FormStateInterface $form_state) {
       '#title' => t('Default time zone'),
       '#default_value' => $system_date->get('timezone.default') ?: date_default_timezone_get(),
       '#options' => $zones,
+      // Use the Select2 library.
+      '#select2' => TRUE,
     );
 
     $configurable_timezones = $system_date->get('timezone.user.configurable');
